Saringosterol 3-glucoside
Internal ID | f8b4bba2-efa7-49c9-b6d3-e90561807742 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 2-(hydroxymethyl)-6-[[17-(5-hydroxy-5-propan-2-ylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC(C)C(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)(C=C)O |
SMILES (Isomeric) | CC(C)C(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)(C=C)O |
InChI | InChI=1S/C35H58O7/c1-7-35(40,20(2)3)17-12-21(4)25-10-11-26-24-9-8-22-18-23(13-15-33(22,5)27(24)14-16-34(25,26)6)41-32-31(39)30(38)29(37)28(19-36)42-32/h7-8,20-21,23-32,36-40H,1,9-19H2,2-6H3 |
InChI Key | MRNRLEVLPFVWRY-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C35H58O7 |
Molecular Weight | 590.80 g/mol |
Exact Mass | 590.41825418 g/mol |
Topological Polar Surface Area (TPSA) | 120.00 Ų |
XlogP | 5.90 |
CHEBI:172762 |
2-(hydroxymethyl)-6-[[17-(5-hydroxy-5-propan-2-ylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.24% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.77% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.16% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.03% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.24% | 98.95% |
CHEMBL237 | P41145 | Kappa opioid receptor | 93.22% | 98.10% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.40% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.15% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.78% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.77% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.46% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.80% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.04% | 86.33% |
CHEMBL1977 | P11473 | Vitamin D receptor | 83.86% | 99.43% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.80% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.58% | 94.73% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.76% | 89.05% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.41% | 93.18% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.19% | 97.79% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.62% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.30% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.18% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax ginseng |
PubChem | 131750895 |
LOTUS | LTS0108093 |
wikiData | Q105170759 |