sarcostolide E
| Internal ID | d8245b58-d1c6-4bdd-aa0b-4696808719f9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (5Z,7E,9S,12R,13S)-5,9-dimethyl-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5,7-triene-3,10,15-trione |
| SMILES (Canonical) | CC1C=CC=C(CC(=O)CC2=CC(C(CC1=O)C(C)C)OC2=O)C |
| SMILES (Isomeric) | C[C@H]1/C=C/C=C(\CC(=O)CC2=C[C@H]([C@H](CC1=O)C(C)C)OC2=O)/C |
| InChI | InChI=1S/C20H26O4/c1-12(2)17-11-18(22)14(4)7-5-6-13(3)8-16(21)9-15-10-19(17)24-20(15)23/h5-7,10,12,14,17,19H,8-9,11H2,1-4H3/b7-5+,13-6-/t14-,17+,19+/m0/s1 |
| InChI Key | BMKPIWHFMRABEY-PKOCSPPNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 3.00 |
| CHEMBL488480 |
| (5Z,7E,9S,12R,13S)-5,9-Dimethyl-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),5,7-triene-3,10,15-trione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.56% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 92.61% | 94.80% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.58% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.44% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.65% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.74% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.83% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.53% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.43% | 93.56% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.41% | 86.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.38% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25015065 |
| LOTUS | LTS0108692 |
| wikiData | Q104938430 |