Sarcocapnidine
| Internal ID | cec21d05-7b39-4378-bd9a-6d5e440d40a8 |
| Taxonomy | Alkaloids and derivatives > Cularin alkaloids and derivatives |
| IUPAC Name | (10S)-5,17-dimethoxy-11-methyl-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3(8),4,6,14(18),15-hexaen-4-ol |
| SMILES (Canonical) | CN1CCC2=C3C1CC4=C(C(=C(C=C4)OC)O)OC3=C(C=C2)OC |
| SMILES (Isomeric) | CN1CCC2=C3[C@@H]1CC4=C(C(=C(C=C4)OC)O)OC3=C(C=C2)OC |
| InChI | InChI=1S/C19H21NO4/c1-20-9-8-11-4-7-15(23-3)19-16(11)13(20)10-12-5-6-14(22-2)17(21)18(12)24-19/h4-7,13,21H,8-10H2,1-3H3/t13-/m0/s1 |
| InChI Key | IJSPIEAJJJWASA-ZDUSSCGKSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 3.00 |
| CHEMBL510777 |
| BDBM50292458 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.02% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 93.25% | 95.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.37% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.81% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.54% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.28% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.69% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.42% | 91.49% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.91% | 90.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.68% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.26% | 92.94% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.94% | 95.78% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.86% | 89.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.74% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.28% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.94% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.17% | 85.14% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.01% | 93.65% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.58% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.33% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.09% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sarcocapnos baetica |
| Sarcocapnos crassifolia |
| Sarcocapnos enneaphylla |
| PubChem | 11099480 |
| LOTUS | LTS0221420 |
| wikiData | Q104251724 |