Saphenic amide
| Internal ID | 93633a7f-3b31-442e-9b56-bcff14ee6d4b |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 6-[(1R)-1-hydroxyethyl]phenazine-1-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H13N3O2/c1-8(19)9-4-2-6-11-13(9)17-12-7-3-5-10(15(16)20)14(12)18-11/h2-8,19H,1H3,(H2,16,20)/t8-/m1/s1 |
| InChI Key | VBPMINZZMCSTBX-MRVPVSSYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.100776666 g/mol |
| Topological Polar Surface Area (TPSA) | 89.10 Ų |
| XlogP | 1.00 |
| 6-[(1R)-1-hydroxyethyl]phenazine-1-carboxamide |
| 6-((1R)-1-hydroxyethyl)phenazine-1-carboxamide |
| 6-((1R)-1-Hydroxyethyl)phenazine-1-carboximidate |
| 6-[(1R)-1-Hydroxyethyl]phenazine-1-carboximidate |
| RefChem:181218 |
| CHEBI:208666 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.73% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.19% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.10% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.97% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.42% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.50% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.42% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.30% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.97% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.33% | 94.73% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.39% | 93.81% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.27% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.34% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683028 |
| LOTUS | LTS0129419 |
| wikiData | Q105283404 |