Santolina triene
| Internal ID | 048f6c1e-b3da-4a2d-afcb-a75bf7063d06 |
| Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Branched unsaturated hydrocarbons |
| IUPAC Name | 3-ethenyl-2,5-dimethylhexa-1,4-diene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H16/c1-6-10(9(4)5)7-8(2)3/h6-7,10H,1,4H2,2-3,5H3 |
| InChI Key | ZQGDEJAPCUGBRH-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.23 g/mol |
| Exact Mass | 136.125200510 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.20 |
| 3-ethenyl-2,5-dimethylhexa-1,4-diene |
| DTXSID90880656 |
| RefChem:181211 |
| DTXCID801022023 |
| ZQGDEJAPCUGBRH-UHFFFAOYSA-N |
| 2,5-Dimethyl-3-vinyl-1,4-hexadiene |
| 2153-66-4 |
| 1,4-Hexadiene,3-ethenyl-2,5-dimethyl- |
| SCHEMBL30105682 |
| CHEBI:90018 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.79% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.86% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.74% | 91.49% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 83.71% | 97.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.24% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia arbuscula |
| Artemisia tridentata |
| Citrus × aurantium |
| Citrus trifoliata |
| Curcuma zedoaria |
| Portulaca oleracea |
| Santolina chamaecyparissus |
| Schisandra chinensis |
| Syzygium aromaticum |
| PubChem | 519872 |
| NPASS | NPC13428 |
| LOTUS | LTS0155913 |
| wikiData | Q27162243 |