Sanguilutine
| Internal ID | 3edf4cc3-eefc-45d3-b7d6-182da5cf50f6 |
| Taxonomy | Alkaloids and derivatives > Benzophenanthridine alkaloids > Quaternary benzophenanthridine alkaloids |
| IUPAC Name | 2,3,7,8,10-pentamethoxy-5-methylbenzo[c]phenanthridin-5-ium |
| SMILES (Canonical) | C[N+]1=C2C(=C3C(=CC(=C(C3=C1)OC)OC)OC)C=CC4=CC(=C(C=C42)OC)OC |
| SMILES (Isomeric) | C[N+]1=C2C(=C3C(=CC(=C(C3=C1)OC)OC)OC)C=CC4=CC(=C(C=C42)OC)OC |
| InChI | InChI=1S/C23H24NO5/c1-24-12-16-21(19(27-4)11-20(28-5)23(16)29-6)14-8-7-13-9-17(25-2)18(26-3)10-15(13)22(14)24/h7-12H,1-6H3/q+1 |
| InChI Key | QXVJDCUNQFSDBQ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C23H24NO5+ |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16544787 g/mol |
| Topological Polar Surface Area (TPSA) | 50.00 Ų |
| XlogP | 4.70 |
| C12228 |
| 2,3,7,8,10-pentamethoxy-5-methylbenzo[c]phenanthridin-5-ium |
| benzo[c]phenanthridinium, 2,3,7,8,10-pentamethoxy-5-methyl- |
| 2,3,7,8,10-pentamethoxy-5-methyl-benzo[c]phenanthridin-5-ium |
| AC1L78VG |
| AC1Q57Z2 |
| CHEBI:32116 |
| Q27114787 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.55% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.36% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.21% | 89.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.82% | 92.94% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.80% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.15% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.69% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.66% | 91.11% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.55% | 94.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.80% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.74% | 96.09% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.59% | 92.38% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.18% | 93.31% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 81.03% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.60% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sanguinaria canadensis |
| PubChem | 356660 |
| LOTUS | LTS0008367 |
| wikiData | Q27114787 |