Salinipeptin D
| Internal ID | 3f287433-0dcb-4d93-a3b5-89a1940a5936 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (2R)-N-[(2S)-1-[[(2S)-1-[[(2R,3R)-1-[[(2R)-5-amino-1-[[2-[[(2S)-3-hydroxy-1-[[(Z)-1-[[(2R,3R)-3-methyl-1-[[(2Z,6S,9S,12R)-9-(2-methylpropyl)-5,8,11-trioxo-6-propan-2-yl-1-thia-4,7,10-triazacyclotridec-2-en-12-yl]amino]-1-oxopentan-2-yl]amino]-1-oxobut-2-en-2-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-2-[[(2R)-2-[[(2R)-2-[[(2S,3R)-2-[[(2R)-1-[(Z)-2-[[(2R)-2-[[(2R)-1-[(Z)-2-[[(2S)-2-(dimethylamino)propanoyl]amino]but-2-enoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]but-2-enoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]propanoyl]amino]pentanediamide |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCC(=O)N)C(=O)NCC(=O)NC(CO)C(=O)NC(=CC)C(=O)NC(C(C)CC)C(=O)NC1CSC=CNC(=O)C(NC(=O)C(NC1=O)CC(C)C)C(C)C)NC(=O)C(C(C)C)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C(C)O)NC(=O)C3CCCN3C(=O)C(=CC)NC(=O)C(C)NC(=O)C4CCCN4C(=O)C(=CC)NC(=O)C(C)N(C)C |
| SMILES (Isomeric) | CC[C@@H](C)[C@H](C(=O)N[C@H](CCC(=O)N)C(=O)NCC(=O)N[C@@H](CO)C(=O)N/C(=C\C)/C(=O)N[C@H]([C@H](C)CC)C(=O)N[C@H]1CS/C=C\NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)CC(C)C)C(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@@H](CCC(=O)N)NC(=O)[C@@H](C)NC(=O)[C@@H](C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]3CCCN3C(=O)/C(=C/C)/NC(=O)[C@@H](C)NC(=O)[C@H]4CCCN4C(=O)/C(=C/C)/NC(=O)[C@H](C)N(C)C |
| InChI | InChI=1S/C97H152N24O25S/c1-21-51(12)75(94(143)113-67-47-147-42-39-100-91(140)73(49(8)9)114-85(134)64(43-48(6)7)111-88(67)137)116-83(132)59(23-3)106-87(136)66(46-122)105-72(126)45-101-82(131)62(35-37-70(98)124)110-93(142)76(52(13)22-2)117-92(141)74(50(10)11)115-86(135)65(44-58-31-27-26-28-32-58)112-84(133)63(36-38-71(99)125)109-80(129)54(15)102-78(127)53(14)104-95(144)77(57(18)123)118-90(139)69-34-30-41-121(69)96(145)60(24-4)107-79(128)55(16)103-89(138)68-33-29-40-120(68)97(146)61(25-5)108-81(130)56(17)119(19)20/h23-28,31-32,39,42,48-57,62-69,73-77,122-123H,21-22,29-30,33-38,40-41,43-47H2,1-20H3,(H2,98,124)(H2,99,125)(H,100,140)(H,101,131)(H,102,127)(H,103,138)(H,104,144)(H,105,126)(H,106,136)(H,107,128)(H,108,130)(H,109,129)(H,110,142)(H,111,137)(H,112,133)(H,113,143)(H,114,134)(H,115,135)(H,116,132)(H,117,141)(H,118,139)/b42-39-,59-23-,60-24-,61-25-/t51-,52-,53-,54-,55-,56+,57-,62-,63-,64+,65+,66+,67+,68-,69-,73+,74+,75-,76-,77+/m1/s1 |
| InChI Key | ASORNVAVRKWGNS-JJLOCILGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C97H152N24O25S |
| Molecular Weight | 2086.50 g/mol |
| Exact Mass | 2086.1114724 g/mol |
| Topological Polar Surface Area (TPSA) | 749.00 Ų |
| XlogP | 0.10 |
| Atomic LogP (AlogP) | -5.13 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 53 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9089 | 90.89% |
| Caco-2 | - | 0.8601 | 86.01% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.5864 | 58.64% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8145 | 81.45% |
| OATP1B3 inhibitior | + | 0.9217 | 92.17% |
| MATE1 inhibitior | - | 0.9012 | 90.12% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9652 | 96.52% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8695 | 86.95% |
| CYP3A4 substrate | + | 0.7573 | 75.73% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8168 | 81.68% |
| CYP3A4 inhibition | - | 0.7216 | 72.16% |
| CYP2C9 inhibition | - | 0.8772 | 87.72% |
| CYP2C19 inhibition | - | 0.8336 | 83.36% |
| CYP2D6 inhibition | - | 0.9036 | 90.36% |
| CYP1A2 inhibition | - | 0.8753 | 87.53% |
| CYP2C8 inhibition | + | 0.8190 | 81.90% |
| CYP inhibitory promiscuity | - | 0.9482 | 94.82% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5841 | 58.41% |
| Eye corrosion | - | 0.9851 | 98.51% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.7582 | 75.82% |
| Skin corrosion | - | 0.9116 | 91.16% |
| Ames mutagenesis | - | 0.6400 | 64.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7211 | 72.11% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.5510 | 55.10% |
| skin sensitisation | - | 0.8502 | 85.02% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | - | 0.7028 | 70.28% |
| Acute Oral Toxicity (c) | III | 0.5641 | 56.41% |
| Estrogen receptor binding | - | 0.5135 | 51.35% |
| Androgen receptor binding | + | 0.7695 | 76.95% |
| Thyroid receptor binding | + | 0.7785 | 77.85% |
| Glucocorticoid receptor binding | + | 0.8359 | 83.59% |
| Aromatase binding | + | 0.8115 | 81.15% |
| PPAR gamma | + | 0.7914 | 79.14% |
| Honey bee toxicity | - | 0.6427 | 64.27% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.7258 | 72.58% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.99% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.90% | 94.45% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.61% | 89.63% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.52% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.35% | 90.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.92% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.67% | 97.64% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.99% | 97.23% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.60% | 88.42% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 97.50% | 93.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 97.43% | 95.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.94% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.92% | 97.14% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.79% | 100.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.76% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.77% | 96.47% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 95.39% | 96.67% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.19% | 95.38% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.80% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.39% | 91.19% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.60% | 95.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.49% | 98.24% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.82% | 98.94% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 92.80% | 82.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.75% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.71% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.26% | 95.56% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.13% | 96.21% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.71% | 90.08% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.35% | 93.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.26% | 93.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.26% | 82.69% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.21% | 94.66% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.78% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.55% | 96.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.34% | 99.35% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.16% | 90.71% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.47% | 96.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.22% | 93.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.82% | 89.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.67% | 96.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.41% | 96.90% |
| CHEMBL4072 | P07858 | Cathepsin B | 87.37% | 93.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.90% | 89.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.54% | 95.89% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 86.49% | 96.67% |
| CHEMBL4801 | P29466 | Caspase-1 | 86.39% | 96.85% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 85.97% | 98.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.97% | 95.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.49% | 95.83% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.35% | 95.71% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 83.74% | 95.20% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.33% | 91.81% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.30% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.09% | 99.18% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.37% | 96.25% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.23% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.92% | 97.50% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.87% | 96.37% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.85% | 98.75% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 81.29% | 98.89% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 81.01% | 93.33% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.83% | 96.11% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.35% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682336 |
| LOTUS | LTS0101319 |
| wikiData | Q104917974 |