Salinaphthoquinone A
| Internal ID | 5d496fc8-a1b0-4d6d-8ee7-6477a807e434 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 2-amino-5,6-dihydroxy-7-methylnaphthalene-1,4-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H9NO4/c1-4-2-5-8(11(16)9(4)14)7(13)3-6(12)10(5)15/h2-3,14,16H,12H2,1H3 |
| InChI Key | QRKANCOSNBOSFF-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.05315777 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 1.20 |
| CHEMBL4466232 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.27% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.12% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.01% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.15% | 91.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.86% | 90.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.29% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.01% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.08% | 94.42% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.82% | 94.73% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.81% | 93.18% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.63% | 90.24% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.37% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.27% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.27% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.23% | 99.23% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.22% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721042 |
| LOTUS | LTS0232255 |
| wikiData | Q104196125 |