Salfredin C1
| Internal ID | f6ab5c4d-f144-485a-bfac-9072ec811d64 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolyl carboxylic acids and derivatives |
| IUPAC Name | (2R)-2-[(2S)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro[3,2-f]isoindol-2-yl]propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H11NO6/c1-4(13(18)19)7-2-5-8(20-7)3-6-9(10(5)15)12(17)14-11(6)16/h3-4,7,15H,2H2,1H3,(H,18,19)(H,14,16,17)/t4-,7+/m1/s1 |
| InChI Key | RVAJKUWZAXLXGY-FBCQKBJTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.05863707 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 1.10 |
| (2R)-2-((2S)-4,7-Dihydroxy-5-oxo-2H,3H,5H-furo(2,3-F)isoindol-2-yl)propanoate |
| (2R)-2-((2S)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro(3,2-f)isoindol-2-yl)propanoic acid |
| (2R)-2-[(2S)-4,7-Dihydroxy-5-oxo-2H,3H,5H-furo[2,3-F]isoindol-2-yl]propanoate |
| (2R)-2-[(2S)-4-hydroxy-5,7-dioxo-2,3-dihydrofuro[3,2-f]isoindol-2-yl]propanoic acid |
| RefChem:180904 |
| SCHEMBL15147463 |
| CHEBI:202634 |
| (2R)-2-[(2S)-4-hydroxy-5,7-dioxo-2,3-dihydrouro[3,2-]isoindol-2-yl]propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.48% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.46% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.20% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.59% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 91.59% | 85.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.01% | 90.71% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.52% | 95.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.85% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.73% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.57% | 85.14% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.37% | 98.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.06% | 95.89% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.70% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.77% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.48% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.81% | 96.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.64% | 92.88% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.16% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11778250 |
| LOTUS | LTS0204989 |
| wikiData | Q77372561 |