(S)-N-Methylcanadine
Internal ID | b1216fd3-b680-4ff0-abb0-9a461ee0fdff |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | (1S)-16,17-dimethoxy-13-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
SMILES (Canonical) | C[N+]12CCC3=CC4=C(C=C3C1CC5=C(C2)C(=C(C=C5)OC)OC)OCO4 |
SMILES (Isomeric) | C[N+]12CCC3=CC4=C(C=C3[C@@H]1CC5=C(C2)C(=C(C=C5)OC)OC)OCO4 |
InChI | InChI=1S/C21H24NO4/c1-22-7-6-14-9-19-20(26-12-25-19)10-15(14)17(22)8-13-4-5-18(23-2)21(24-3)16(13)11-22/h4-5,9-10,17H,6-8,11-12H2,1-3H3/q+1/t17-,22?/m0/s1 |
InChI Key | IPABSWBNWMXCHM-LBOXEOMUSA-N |
Popularity | 5 references in papers |
Molecular Formula | C21H24NO4+ |
Molecular Weight | 354.40 g/mol |
Exact Mass | 354.17053325 g/mol |
Topological Polar Surface Area (TPSA) | 36.90 Ų |
XlogP | 3.10 |
N-Methylcanadium (iodide) |
(13aS)-9,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-2H,6H-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolinium |
SCHEMBL16486418 |
CHEBI:16512 |
C02915 |
Q27101951 |
(1S)-16,17-dimethoxy-13-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL261 | P00915 | Carbonic anhydrase I | 99.02% | 96.76% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.46% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.17% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.45% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.65% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.77% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.25% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.02% | 92.62% |
CHEMBL205 | P00918 | Carbonic anhydrase II | 90.41% | 98.44% |
CHEMBL2535 | P11166 | Glucose transporter | 90.33% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.41% | 82.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.25% | 95.56% |
CHEMBL240 | Q12809 | HERG | 87.19% | 89.76% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 87.17% | 80.96% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.49% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.36% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.11% | 93.40% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.04% | 96.09% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.80% | 95.12% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.31% | 83.82% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.70% | 96.86% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 83.00% | 88.48% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.06% | 89.05% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.96% | 94.03% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.91% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.89% | 94.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.56% | 96.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.10% | 91.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.00% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.63% | 97.09% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.00% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fumaria officinalis |
Thalictrum minus |
PubChem | 439844 |
LOTUS | LTS0056735 |
wikiData | Q27101951 |