(S)-Atpa
| Internal ID | 7e81a8a2-8332-4063-8ff5-c93d132aa6d7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids > L-alpha-amino acids |
| IUPAC Name | (2S)-2-amino-3-(5-tert-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
| SMILES (Canonical) | CC(C)(C)C1=C(C(=O)NO1)CC(C(=O)O)N |
| SMILES (Isomeric) | CC(C)(C)C1=C(C(=O)NO1)C[C@@H](C(=O)O)N |
| InChI | InChI=1S/C10H16N2O4/c1-10(2,3)7-5(8(13)12-16-7)4-6(11)9(14)15/h6H,4,11H2,1-3H3,(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChI Key | PIXJURSCCVBKRF-LURJTMIESA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11100700 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | -1.90 |
| CHEMBL27130 |
| CHEBI:34019 |
| (2S)-2-amino-3-(5-tert-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
| 4-Isoxazolepropanoicacid, a-amino-5-(1,1-dimethylethyl)-2,3-dihydro-3-oxo- |
| 3-(5-tert-butyl-3-hydroxy-1,2-oxazol-4-yl)-L-alanine |
| 1nnk |
| Tocris-1107 |
| ATPA-R |
| SCHEMBL4992380 |
| BDBM85742 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.50% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.77% | 97.25% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.10% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.34% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.22% | 99.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.83% | 99.35% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.04% | 94.45% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.76% | 92.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.31% | 94.73% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.15% | 80.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.83% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.24% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.01% | 96.95% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.93% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 447407 |
| LOTUS | LTS0058500 |
| wikiData | Q27096378 |