S-adenosyl-L-homocysteine
Internal ID | 987c8c8e-7166-48bd-9638-6cadcec182c6 |
Taxonomy | Nucleosides, nucleotides, and analogues > 5-deoxyribonucleosides > 5-deoxy-5-thionucleosides |
IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
SMILES (Canonical) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CSCCC(C(=O)O)N)O)O)N |
SMILES (Isomeric) | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CSCC[C@@H](C(=O)O)N)O)O)N |
InChI | InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1 |
InChI Key | ZJUKTBDSGOFHSH-WFMPWKQPSA-N |
Popularity | 5,670 references in papers |
Molecular Formula | C14H20N6O5S |
Molecular Weight | 384.41 g/mol |
Exact Mass | 384.12158893 g/mol |
Topological Polar Surface Area (TPSA) | 208.00 Ų |
XlogP | -3.50 |
Atomic LogP (AlogP) | -1.44 |
H-Bond Acceptor | 11 |
H-Bond Donor | 5 |
Rotatable Bonds | 7 |
S-adenosyl-L-homocysteine |
979-92-0 |
AdoHcy |
S-(5'-adenosyl)-L-homocysteine |
S-(5'-deoxyadenosin-5'-yl)-L-homocysteine |
adenosylhomocysteine |
Formycinylhomocysteine |
5'-Deoxy-S-adenosyl-L-homocysteine |
Adenosyl-L-homocysteine |
L-Homocysteine, S-(5'-deoxyadenosin-5'-yl)- |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7845 | 78.45% |
Caco-2 | - | 0.8795 | 87.95% |
Blood Brain Barrier | - | 0.5500 | 55.00% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Nucleus | 0.3476 | 34.76% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9399 | 93.99% |
OATP1B3 inhibitior | + | 0.9425 | 94.25% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.8916 | 89.16% |
BSEP inhibitior | - | 0.6445 | 64.45% |
P-glycoprotein inhibitior | - | 0.7498 | 74.98% |
P-glycoprotein substrate | - | 0.6973 | 69.73% |
CYP3A4 substrate | + | 0.5073 | 50.73% |
CYP2C9 substrate | - | 0.8000 | 80.00% |
CYP2D6 substrate | - | 0.8386 | 83.86% |
CYP3A4 inhibition | - | 0.9017 | 90.17% |
CYP2C9 inhibition | - | 0.9086 | 90.86% |
CYP2C19 inhibition | - | 0.8862 | 88.62% |
CYP2D6 inhibition | - | 0.9295 | 92.95% |
CYP1A2 inhibition | - | 0.9028 | 90.28% |
CYP2C8 inhibition | - | 0.7578 | 75.78% |
CYP inhibitory promiscuity | - | 0.9323 | 93.23% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.5871 | 58.71% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.9840 | 98.40% |
Skin irritation | - | 0.7577 | 75.77% |
Skin corrosion | - | 0.9315 | 93.15% |
Ames mutagenesis | - | 0.6869 | 68.69% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7440 | 74.40% |
Micronuclear | + | 0.9500 | 95.00% |
Hepatotoxicity | - | 0.7163 | 71.63% |
skin sensitisation | - | 0.8717 | 87.17% |
Respiratory toxicity | + | 0.9000 | 90.00% |
Reproductive toxicity | + | 0.9667 | 96.67% |
Mitochondrial toxicity | + | 0.9625 | 96.25% |
Nephrotoxicity | - | 0.9177 | 91.77% |
Acute Oral Toxicity (c) | III | 0.6165 | 61.65% |
Estrogen receptor binding | + | 0.7379 | 73.79% |
Androgen receptor binding | - | 0.6348 | 63.48% |
Thyroid receptor binding | + | 0.6082 | 60.82% |
Glucocorticoid receptor binding | + | 0.5377 | 53.77% |
Aromatase binding | + | 0.6823 | 68.23% |
PPAR gamma | + | 0.6273 | 62.73% |
Honey bee toxicity | - | 0.8851 | 88.51% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.7200 | 72.00% |
Fish aquatic toxicity | - | 0.6479 | 64.79% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 |
200 nM |
IC50 |
via Super-PRED
|
CHEMBL5406 | Q86X55 | Histone-arginine methyltransferase CARM1 |
400 nM |
Ki |
via Super-PRED
|
CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific |
170 nM 150 nM |
IC50 Kd |
via Super-PRED
via Super-PRED |
CHEMBL6032 | Q96KQ7 | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 |
570 nM |
Ki |
via Super-PRED
|
CHEMBL6031 | Q9H9B1 | Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 |
230 nM |
IC50 |
via Super-PRED
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
125.9 nM |
Potency |
via Super-PRED
|
CHEMBL3137261 | O14744 | PRMT5/MEP50 complex |
560 nM |
IC50 |
via Super-PRED
|
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 |
420 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.23% | 96.09% |
CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 92.62% | 95.48% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.11% | 83.82% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 87.39% | 80.33% |
CHEMBL3589 | P55263 | Adenosine kinase | 87.13% | 98.05% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.28% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 84.54% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.63% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.24% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.15% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.10% | 91.11% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 80.76% | 88.84% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.29% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.26% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lycopersicum |
PubChem | 439155 |
LOTUS | LTS0163370 |
wikiData | Q307434 |