(S)-8,8-Dimethyl-2-oxo-7,8-dihydro-2H,6H-pyrano(3,2-g)chromen-7-yl 3-methyl-2-butenoate
Internal ID | 07a838c6-5161-43d6-8482-0fdd0a2ba533 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Linear pyranocoumarins |
IUPAC Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-methylbut-2-enoate |
SMILES (Canonical) | CC(=CC(=O)OC1CC2=C(C=C3C(=C2)C=CC(=O)O3)OC1(C)C)C |
SMILES (Isomeric) | CC(=CC(=O)OC1CC2=C(C=C3C(=C2)C=CC(=O)O3)OC1(C)C)C |
InChI | InChI=1S/C19H20O5/c1-11(2)7-18(21)23-16-9-13-8-12-5-6-17(20)22-14(12)10-15(13)24-19(16,3)4/h5-8,10,16H,9H2,1-4H3 |
InChI Key | CUKSFECWKQBVED-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H20O5 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 3.90 |
CUKSFECWKQBVED-UHFFFAOYSA-N |
FT-0771078 |
A832241 |
B2703-479866 |
(2,2-dimethyl-8-oxidanylidene-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-methylbut-2-enoate |
(S)-8,8-Dimethyl-2-oxo-7,8-dihydro-2H,6H-pyrano(3,2-g)chromen-7-yl 3-methyl-2-butenoate |
3-methyl-2-butenoic acid (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g][1]benzopyran-3-yl) ester |
8,8-Dimethyl-2-oxo-7,8-dihydro-2H,6H-pyrano[3,2-g]chromen-7-yl 3-methyl-2-butenoate-, (S)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.10% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.37% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.45% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.33% | 96.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.45% | 85.30% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.52% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.79% | 99.23% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.42% | 92.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.30% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.29% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.08% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.45% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.75% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.93% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.64% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica decursiva |
Angelica gigas |
PubChem | 611537 |
LOTUS | LTS0178978 |
wikiData | Q104970336 |