(S)-2,3-Dihydro-5,7-dihydroxy-6-methyl-2-phenyl-4-benzopyrone
| Internal ID | 35bd40a8-d406-4a30-b2b6-1abcb6a8eb56 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
| IUPAC Name | 5,7-dihydroxy-6-methyl-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC=CC=C3)O |
| SMILES (Isomeric) | CC1=C(C2=C(C=C1O)OC(CC2=O)C3=CC=CC=C3)O |
| InChI | InChI=1S/C16H14O4/c1-9-11(17)7-14-15(16(9)19)12(18)8-13(20-14)10-5-3-2-4-6-10/h2-7,13,17,19H,8H2,1H3 |
| InChI Key | INBPQAJYHSJVRY-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 3.10 |
| 11023-71-5 |
| 5,7-dihydroxy-6-methyl-2-phenyl-2,3-dihydrochromen-4-one |
| CHEMBL1556958 |
| 5,7-DIHYDROXY-6-METHYLFLAVANONE |
| EINECS 234-254-0 |
| MLS000876950 |
| cid_114429 |
| MEGxp0_000550 |
| SCHEMBL4740199 |
| ACon1_000727 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.31% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.36% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.37% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.67% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.08% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.49% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.44% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.56% | 99.15% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.88% | 85.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.20% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus sieboldiana |
| Bauhinia purpurea |
| Pinus bungeana |
| Pinus krempfii |
| Pinus lambertiana |
| Pinus monticola |
| Piper hostmannianum |
| Pseudotsuga sinensis var. sinensis |
| Syzygium samarangense |
| PubChem | 114429 |
| LOTUS | LTS0075777 |
| wikiData | Q82881695 |