Ryanadol
Internal ID | 25e0c199-fcf3-4c7f-9ea6-9c3cd242d7fe |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (2,6,9,11,13,14-hexahydroxy-3,7,10-trimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadecan-12-yl) 1H-pyrrole-2-carboxylate |
SMILES (Canonical) | CC1CCC2(C3(CC4(C5(C(C(C3(C5(C2(C1O)O4)O)O)OC(=O)C6=CC=CN6)(C(C)C)O)C)O)C)O |
SMILES (Isomeric) | CC1CCC2(C3(CC4(C5(C(C(C3(C5(C2(C1O)O4)O)O)OC(=O)C6=CC=CN6)(C(C)C)O)C)O)C)O |
InChI | InChI=1S/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3 |
InChI Key | JJSYXNQGLHBRRK-UHFFFAOYSA-N |
Popularity | 2,899 references in papers |
Molecular Formula | C25H35NO9 |
Molecular Weight | 493.50 g/mol |
Exact Mass | 493.23118169 g/mol |
Topological Polar Surface Area (TPSA) | 173.00 Ų |
XlogP | -0.50 |
15662-33-6 |
CHEMBL308183 |
NSC114572 |
Ryanadol |
NSC-114572 |
Ryanodine Derivative |
10-epi-hydroxy-Ryanodine |
3-(1H-pyrrole-2-carboxylate) |
DTXSID20860168 |
BDBM50051434 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.17% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.87% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.75% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.50% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.05% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.77% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.54% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.71% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.56% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.45% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.27% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.10% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.61% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.10% | 100.00% |
CHEMBL4072 | P07858 | Cathepsin B | 81.65% | 93.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.20% | 99.23% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.97% | 82.69% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.05% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ryania speciosa |
PubChem | 5114 |
LOTUS | LTS0217759 |
wikiData | Q105129882 |