Rutin hydrate
Internal ID | 98d6219d-b831-4c23-aab8-0a3db59e6c3b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one;hydrate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O.O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O.O |
InChI | InChI=1S/C27H30O16.H2O/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9;/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3;1H2/t8-,15+,17-,18+,20+,21-,22+,23+,26+,27-;/m0./s1 |
InChI Key | PGHSKTKIQIBATG-ZAAWVBGYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C27H32O17 |
Molecular Weight | 628.50 g/mol |
Exact Mass | 628.16394955 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | 0.00 |
207671-50-9 |
190836-14-7 |
RUTIN HYDRATE 95 |
Rutinhydrate |
rutin monohydrate |
Rutin hydrate, 95% |
MLS002207166 |
SCHEMBL592315 |
CHEMBL1883743 |
MFCD01319140 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5422 | P07237 | Protein disulfide-isomerase |
7620 nM |
AC50 |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.60% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.80% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.69% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.54% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.22% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.65% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.68% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.47% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.04% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.29% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.94% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.30% | 95.56% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.73% | 93.65% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.53% | 94.80% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.54% | 95.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.49% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.10% | 97.36% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.33% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gardenia jasminoides |
Ginkgo biloba |
PubChem | 45479757 |
NPASS | NPC203259 |
ChEMBL | CHEMBL1883743 |