Rufoolivacin D
| Internal ID | 11fdcc0a-8276-4d06-9c6d-0a114a2e1fa7 |
| Taxonomy | Lignans, neolignans and related compounds > Arylnaphthalene lignans |
| IUPAC Name | 10-(3-acetyl-4-hydroxy-5,7-dimethoxy-2-methylnaphthalen-1-yl)-9-hydroxy-3-(hydroxymethyl)-6,8-dimethoxyanthracene-1,2-dione |
| SMILES (Canonical) | CC1=C(C2=C(C(=CC(=C2)OC)OC)C(=C1C(=O)C)O)C3=C4C=C(C(=O)C(=O)C4=C(C5=C3C=C(C=C5OC)OC)O)CO |
| SMILES (Isomeric) | CC1=C(C2=C(C(=CC(=C2)OC)OC)C(=C1C(=O)C)O)C3=C4C=C(C(=O)C(=O)C4=C(C5=C3C=C(C=C5OC)OC)O)CO |
| InChI | InChI=1S/C32H28O10/c1-13-23(14(2)34)30(36)26-19(8-16(39-3)10-21(26)41-5)24(13)25-18-7-15(12-33)29(35)32(38)28(18)31(37)27-20(25)9-17(40-4)11-22(27)42-6/h7-11,33,36-37H,12H2,1-6H3 |
| InChI Key | WLKOLVJMGPYJDT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H28O10 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.16824709 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.97% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.04% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.95% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.17% | 94.45% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.83% | 86.92% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.81% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.29% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.89% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.96% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.67% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.74% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.97% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.86% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.85% | 99.17% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.68% | 94.42% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.63% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46868703 |
| LOTUS | LTS0207673 |
| wikiData | Q77378958 |