Rubrolide F
| Internal ID | f97036d4-6362-483a-8a0e-775718f4c83f |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (5Z)-4-(4-hydroxyphenyl)-5-[(4-methoxyphenyl)methylidene]furan-2-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C=C2C(=CC(=O)O2)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C\2/C(=CC(=O)O2)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C18H14O4/c1-21-15-8-2-12(3-9-15)10-17-16(11-18(20)22-17)13-4-6-14(19)7-5-13/h2-11,19H,1H3/b17-10- |
| InChI Key | CNUDKAZLLHGKCY-YVLHZVERSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.10 |
| (5Z)-4-(4-hydroxyphenyl)-5-((4-methoxyphenyl)methylidene)furan-2-one |
| (5Z)-4-(4-hydroxyphenyl)-5-[(4-methoxyphenyl)methylidene]furan-2-one |
| RefChem:180255 |
| CHEMBL2152637 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.85% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.05% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.23% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.68% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.38% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.19% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.10% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.16% | 95.50% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.97% | 83.57% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.78% | 94.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 82.23% | 96.12% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 82.16% | 98.35% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.53% | 91.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.88% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15071722 |
| LOTUS | LTS0123713 |
| wikiData | Q104966351 |