rubiarboside G 28-acetate
Internal ID | 53538f2d-6ba4-4449-b6e6-58fc2c2bc355 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1R,3S,3aR,5aS,5bS,6S,7aR,9S,11aS,13aR,13bR)-1,6-dihydroxy-5a,8,8,11a,13a-pentamethyl-3-propan-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
SMILES (Canonical) | CC(C)C1CC(C2C1(CCC3(C2(CC=C4C3C(CC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)O)C)C)COC(=O)C)O |
SMILES (Isomeric) | CC(C)[C@@H]1C[C@H]([C@H]2[C@]1(CC[C@@]3([C@@]2(CC=C4[C@H]3[C@H](C[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O)C)O)C)C)COC(=O)C)O |
InChI | InChI=1S/C44H72O15/c1-20(2)23-15-25(48)37-43(8)12-9-22-30(42(43,7)13-14-44(23,37)19-56-21(3)46)24(47)16-28-40(4,5)29(10-11-41(22,28)6)59-39-36(54)34(52)32(50)27(58-39)18-55-38-35(53)33(51)31(49)26(17-45)57-38/h9,20,23-39,45,47-54H,10-19H2,1-8H3/t23-,24-,25+,26+,27+,28-,29-,30-,31+,32+,33-,34-,35+,36+,37+,38+,39-,41+,42-,43+,44+/m0/s1 |
InChI Key | IWIDIYBHYIVHDJ-CDWPMCCOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C44H72O15 |
Molecular Weight | 841.00 g/mol |
Exact Mass | 840.48712159 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | 1.80 |
CHEBI:69508 |
CHEMBL1835875 |
DTXSID201100326 |
Q27137847 |
[(1R,3S,3aR,5aS,5bS,6S,7aR,9S,11aS,13aR,13bR)-9-{[6-O-(beta-D-glucopyranosyl)-beta-D-glucopyranosyl]oxy}-1,6-dihydroxy-5a,8,8,11a,13a-pentamethyl-3-(propan-2-yl)-1,2,3,4,5,5a,5b,6,7,7a,8,9,10,11,11a,13,13a,13b-octadecahydro-3aH-cyclopenta[a]chrysen-3a-yl]methyl acetate |
1338588-90-1 |
28-acetoxy-3beta,7beta,19alpha-trihydroxyarbor- 9(11)-en-3-O-beta-D-glucopyranosyl-(1->6)-beta-D-glucopyranoside |
beta-D-Glucopyranoside, (3beta,7beta,19alpha,21beta)-17-[(acetyloxy)methyl]-7,19-dihydroxy-13-methyl-A'-neo-26,28-dinorgammacer-9(11)-en-3-yl 6-O-beta-D-glucopyranosyl- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.56% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.83% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.88% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.46% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.69% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.60% | 98.95% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.31% | 89.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.53% | 97.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.95% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.69% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.71% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.94% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.59% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.40% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 84.71% | 97.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.13% | 95.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.54% | 95.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.42% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.21% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.11% | 94.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.62% | 82.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.38% | 91.24% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.05% | 97.14% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.75% | 94.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.12% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rubia yunnanensis |
PubChem | 56600068 |
NPASS | NPC114188 |
ChEMBL | CHEMBL1835875 |
LOTUS | LTS0124341 |
wikiData | Q27137847 |