(RS)-Nandinine
Internal ID | 7e611d76-f8ac-4f43-8989-4e83eea4a150 |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-ol |
SMILES (Canonical) | COC1=C(C2=C(CC3C4=CC5=C(C=C4CCN3C2)OCO5)C=C1)O |
SMILES (Isomeric) | COC1=C(C2=C(CC3C4=CC5=C(C=C4CCN3C2)OCO5)C=C1)O |
InChI | InChI=1S/C19H19NO4/c1-22-16-3-2-11-6-15-13-8-18-17(23-10-24-18)7-12(13)4-5-20(15)9-14(11)19(16)21/h2-3,7-8,15,21H,4-6,9-10H2,1H3 |
InChI Key | PQECCKIOFCWGRJ-UHFFFAOYSA-N |
Popularity | 8 references in papers |
Molecular Formula | C19H19NO4 |
Molecular Weight | 325.40 g/mol |
Exact Mass | 325.13140809 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 2.80 |
Atomic LogP (AlogP) | 2.79 |
H-Bond Acceptor | 5 |
H-Bond Donor | 1 |
Rotatable Bonds | 1 |
Nandinine, DL- |
Tetrahydroberberrubine |
(+/-)-Nandinine |
Nandinine DL-form [MI] |
Nandinine , (+/-)- |
THBru compound |
UNII-QBN8KZ3C3X |
QBN8KZ3C3X |
CHEMBL2314746 |
6H-Benzo(g)-1,3-benzodioxolo(5,6-a)quinolizin-9-ol, 5,8,13,13a-tetrahydro-10-methoxy- |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9382 | 93.82% |
Caco-2 | + | 0.8488 | 84.88% |
Blood Brain Barrier | + | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.8571 | 85.71% |
Subcellular localzation | Mitochondria | 0.6081 | 60.81% |
OATP2B1 inhibitior | - | 0.8627 | 86.27% |
OATP1B1 inhibitior | + | 0.9248 | 92.48% |
OATP1B3 inhibitior | + | 0.9420 | 94.20% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.8333 | 83.33% |
P-glycoprotein inhibitior | - | 0.6783 | 67.83% |
P-glycoprotein substrate | - | 0.6429 | 64.29% |
CYP3A4 substrate | + | 0.6026 | 60.26% |
CYP2C9 substrate | - | 0.6106 | 61.06% |
CYP2D6 substrate | + | 0.6924 | 69.24% |
CYP3A4 inhibition | + | 0.6911 | 69.11% |
CYP2C9 inhibition | - | 0.8655 | 86.55% |
CYP2C19 inhibition | + | 0.8188 | 81.88% |
CYP2D6 inhibition | + | 0.8939 | 89.39% |
CYP1A2 inhibition | + | 0.9082 | 90.82% |
CYP2C8 inhibition | - | 0.6523 | 65.23% |
CYP inhibitory promiscuity | + | 0.5348 | 53.48% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5602 | 56.02% |
Eye corrosion | - | 0.9888 | 98.88% |
Eye irritation | - | 0.9431 | 94.31% |
Skin irritation | - | 0.7340 | 73.40% |
Skin corrosion | - | 0.9413 | 94.13% |
Ames mutagenesis | - | 0.5700 | 57.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6452 | 64.52% |
Micronuclear | + | 0.6100 | 61.00% |
Hepatotoxicity | - | 0.6750 | 67.50% |
skin sensitisation | - | 0.8642 | 86.42% |
Respiratory toxicity | + | 0.9111 | 91.11% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.9375 | 93.75% |
Nephrotoxicity | + | 0.5374 | 53.74% |
Acute Oral Toxicity (c) | III | 0.5210 | 52.10% |
Estrogen receptor binding | + | 0.6607 | 66.07% |
Androgen receptor binding | + | 0.5510 | 55.10% |
Thyroid receptor binding | + | 0.5683 | 56.83% |
Glucocorticoid receptor binding | + | 0.6813 | 68.13% |
Aromatase binding | - | 0.6553 | 65.53% |
PPAR gamma | + | 0.5740 | 57.40% |
Honey bee toxicity | - | 0.8695 | 86.95% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5551 | 55.51% |
Fish aquatic toxicity | + | 0.7209 | 72.09% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4081 | P13726 | Coagulation factor III |
12.17 nM 36.41 nM 6.75 nM 12.17 nM |
IC50 IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED PMID: 23199480 |
CHEMBL2056 | P21728 | Dopamine D1 receptor |
60 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.90% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.77% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.84% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.21% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.88% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.56% | 93.40% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.01% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 88.79% | 98.95% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.28% | 88.48% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.27% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.63% | 95.89% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.59% | 82.38% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 87.50% | 90.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.25% | 90.71% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.09% | 95.62% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.47% | 89.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.45% | 92.62% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.49% | 91.79% |
CHEMBL2535 | P11166 | Glucose transporter | 84.46% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.14% | 82.67% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.89% | 92.94% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.68% | 96.77% |
CHEMBL5747 | Q92793 | CREB-binding protein | 83.43% | 95.12% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.40% | 89.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.32% | 96.25% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.62% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.11% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.60% | 95.78% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.58% | 96.86% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.11% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis turtschaninovii |
Nandina domestica |
PubChem | 261619 |
NPASS | NPC276944 |
ChEMBL | CHEMBL2314746 |
LOTUS | LTS0046026 |
wikiData | Q103786321 |