Ricciocarpin B
| Internal ID | 0d7776a3-7d8b-41bc-a631-e8c02ba564ab |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans |
| IUPAC Name | (3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one |
| SMILES (Canonical) | CC1(CCCC2C1CC(OC2=O)C3=CC(=O)OC3)C |
| SMILES (Isomeric) | CC1(CCC[C@H]2[C@H]1C[C@H](OC2=O)C3=CC(=O)OC3)C |
| InChI | InChI=1S/C15H20O4/c1-15(2)5-3-4-10-11(15)7-12(19-14(10)17)9-6-13(16)18-8-9/h6,10-12H,3-5,7-8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChI Key | PBCWIAUDNNFHNW-TUAOUCFPSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 2.30 |
| (3S,4aR,8aS)-5,5-dimethyl-3-(5-oxo-2H-furan-3-yl)-4,4a,6,7,8,8a-hexahydro-3H-isochromen-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.25% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.50% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.56% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.73% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.71% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.61% | 85.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.24% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.13% | 94.45% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.04% | 86.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.88% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.85% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.59% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.51% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.24% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.05% | 93.04% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.32% | 94.80% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.21% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.67% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ricciocarpos natans |
| PubChem | 11242514 |
| LOTUS | LTS0185210 |
| wikiData | Q105205076 |