Rhytidchromone C
| Internal ID | 65d16ff9-573c-4753-a32a-897f4939b38a |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | methyl (2R,4S)-4-(5-hydroxy-7-methoxy-2-methyl-4-oxochromen-8-yl)-2,4-dimethoxybutanoate |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C(=C(C=C2O)OC)C(CC(C(=O)OC)OC)OC |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C(=C(C=C2O)OC)[C@H](C[C@H](C(=O)OC)OC)OC |
| InChI | InChI=1S/C18H22O8/c1-9-6-10(19)15-11(20)7-12(22-2)16(17(15)26-9)13(23-3)8-14(24-4)18(21)25-5/h6-7,13-14,20H,8H2,1-5H3/t13-,14+/m0/s1 |
| InChI Key | BKVHVYLMRZGKDR-UONOGXRCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.13146766 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 1.90 |
| methyl (2R,4S)-4-(5-hydroxy-7-methoxy-2-methyl-4-oxochromen-8-yl)-2,4-dimethoxybutanoate |
| RefChem:179336 |
| Methyl (2R,4S)-4-(5-hydroxy-7-methoxy-2-methyl-4-oxo-4H-chromen-8-yl)-2,4-dimethoxybutanoic acid |
| CHEBI:202990 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.49% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.30% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.28% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.37% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.23% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.03% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.36% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.65% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.96% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.16% | 91.19% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.26% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132578877 |
| LOTUS | LTS0127500 |
| wikiData | Q77374711 |