Rheagenine
Internal ID | 78193bc1-1eca-47fb-9ddd-ec8e0a7028ab |
Taxonomy | Alkaloids and derivatives > Rhoeadine alkaloids |
IUPAC Name | (1S,14R,24S)-13-methyl-5,7,19,21,25-pentaoxa-13-azahexacyclo[12.11.0.02,10.04,8.015,23.018,22]pentacosa-2,4(8),9,15(23),16,18(22)-hexaen-24-ol |
SMILES (Canonical) | CN1CCC2=CC3=C(C=C2C4C1C5=C(C(O4)O)C6=C(C=C5)OCO6)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C=C2[C@H]4[C@H]1C5=C([C@H](O4)O)C6=C(C=C5)OCO6)OCO3 |
InChI | InChI=1S/C20H19NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)18-17(21)11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18,20,22H,4-5,8-9H2,1H3/t17-,18+,20+/m1/s1 |
InChI Key | XUYAYNRYVXHNOQ-HBFSDRIKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H19NO6 |
Molecular Weight | 369.40 g/mol |
Exact Mass | 369.12123733 g/mol |
Topological Polar Surface Area (TPSA) | 69.60 Ų |
XlogP | 1.90 |
Rhoeagenine |
16-Methyl-2,3:10,11-bis(methylenebis(oxy))rheadan-8-ol (8beta)- |
Rheadan-8-ol, 16-methyl-2,3:10,11-bis(methylenebis(oxy))-, (8beta)- |
5574-77-6 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.76% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 95.74% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.35% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.22% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.58% | 86.33% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.85% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.84% | 91.11% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.28% | 91.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.84% | 95.89% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.77% | 82.67% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.34% | 92.62% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 82.06% | 96.42% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.78% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.24% | 95.89% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.70% | 96.39% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.68% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.50% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Papaver rhoeas |
PubChem | 12304372 |
LOTUS | LTS0209717 |
wikiData | Q105342722 |