Rhazinicine
| Internal ID | c744c0bb-7d53-4692-8462-b433870ec7f5 |
| Taxonomy | Benzenoids |
| IUPAC Name | (12S)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaene-9,15-dione |
| SMILES (Canonical) | CCC12CCC(=O)NC3=CC=CC=C3C4=C1N(C=C4)C(=O)CC2 |
| SMILES (Isomeric) | CC[C@@]12CCC(=O)NC3=CC=CC=C3C4=C1N(C=C4)C(=O)CC2 |
| InChI | InChI=1S/C19H20N2O2/c1-2-19-10-7-16(22)20-15-6-4-3-5-13(15)14-9-12-21(18(14)19)17(23)8-11-19/h3-6,9,12H,2,7-8,10-11H2,1H3,(H,20,22)/t19-/m0/s1 |
| InChI Key | TXWKUWXSHGUINF-IBGZPJMESA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 51.10 Ų |
| XlogP | 2.50 |
| CHEMBL68701 |
| (12S)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaene-9,15-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.22% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.26% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.60% | 90.17% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.41% | 82.69% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.99% | 89.63% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.88% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.44% | 86.33% |
| CHEMBL228 | P31645 | Serotonin transporter | 87.26% | 95.51% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.85% | 97.25% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 86.60% | 92.97% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.20% | 93.40% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.26% | 96.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.60% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.45% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kopsia singapurensis |
| PubChem | 639955 |
| LOTUS | LTS0173485 |
| wikiData | Q105267057 |