Rha(a1-3)Rha4Ac(a1-3)Rha2Ac4Ac(a1-3)[hexanoyl(-4)]Rha(a)-O-octyl
Internal ID | 358f8b74-de99-48ca-a0ef-8a856aa9d33f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-4-[(2S,3R,4S,5S,6S)-5-acetyloxy-3-hydroxy-6-methyl-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCCCCOC1C(C(C(C(O1)C)OC(=O)CCCCC)OC2C(C(C(C(O2)C)OC(=O)C)OC3C(C(C(C(O3)C)OC(=O)C)OC4C(C(C(C(O4)C)O)O)O)O)OC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)OC(=O)C)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)OC(=O)C)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O)O)OC(=O)C)O |
InChI | InChI=1S/C44H74O21/c1-10-12-14-15-16-18-20-54-41-32(52)37(35(23(5)56-41)62-28(48)19-17-13-11-2)64-44-40(61-27(9)47)39(36(24(6)58-44)60-26(8)46)65-43-33(53)38(34(22(4)57-43)59-25(7)45)63-42-31(51)30(50)29(49)21(3)55-42/h21-24,29-44,49-53H,10-20H2,1-9H3/t21-,22-,23-,24-,29-,30+,31+,32+,33+,34-,35-,36-,37-,38-,39+,40+,41+,42-,43-,44-/m0/s1 |
InChI Key | VIYAYWONMXCWLM-IJYWWYSQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C44H74O21 |
Molecular Weight | 939.00 g/mol |
Exact Mass | 938.47225936 g/mol |
Topological Polar Surface Area (TPSA) | 280.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of Rha(a1-3)Rha4Ac(a1-3)Rha2Ac4Ac(a1-3)[hexanoyl(-4)]Rha(a)-O-octyl 2D Structure of Rha(a1-3)Rha4Ac(a1-3)Rha2Ac4Ac(a1-3)[hexanoyl(-4)]Rha(a)-O-octyl](https://plantaedb.com/storage/docs/compounds/2023/11/rhaa1-3rha4aca1-3rha2ac4aca1-3hexanoyl-4rhaa-o-octyl.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.49% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.31% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.93% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.72% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.96% | 92.08% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.76% | 85.94% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.83% | 97.36% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.51% | 97.29% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.16% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.14% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.67% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.09% | 97.25% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.90% | 94.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.51% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.13% | 96.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.51% | 92.86% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.43% | 81.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.37% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.16% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.54% | 91.49% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.17% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mezzettia parviflora |
PubChem | 101884860 |
LOTUS | LTS0086424 |
wikiData | Q105287090 |