rGuo.P-P-P-P
| Internal ID | 35682bed-7d03-46f4-9b04-4f48999d809a |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;[hydroxy(phosphonooxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H13N5O5.H6O13P4/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9;1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19);(H,7,8)(H,9,10)(H2,1,2,3)(H2,4,5,6)/t3-,5-,6-,9-;/m1./s1 |
| InChI Key | WYKLZQDUKWXSES-GWTDSMLYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H19N5O18P4 |
| Molecular Weight | 621.18 g/mol |
| Exact Mass | 620.96755676 g/mol |
| Topological Polar Surface Area (TPSA) | 373.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.73% | 96.09% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 94.51% | 80.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.41% | 95.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.74% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.21% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.44% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.10% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.71% | 97.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.13% | 86.92% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 85.09% | 95.48% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.53% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.21% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.82% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.16% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.16% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 137217516 |
| LOTUS | LTS0111244 |
| wikiData | Q105322343 |