Reveromycin D
| Internal ID | 7e8812b9-32c7-43d6-b37a-8bd79c4cc9e7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | (2E,4S,5S,6E,8E)-10-[(2S,3R,6S,8R,9S)-2-[(1E,3E)-4-carboxy-3-methylbuta-1,3-dienyl]-3-(3-carboxypropanoyloxy)-9-methyl-3-pentyl-1,7-dioxaspiro[5.5]undecan-8-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid |
| SMILES (Canonical) | CCCCCC1(CCC2(CCC(C(O2)CC=C(C)C=CC(C(C)C=CC(=O)O)O)C)OC1C=CC(=CC(=O)O)C)OC(=O)CCC(=O)O |
| SMILES (Isomeric) | CCCCC[C@]1(CC[C@]2(CC[C@@H]([C@H](O2)C/C=C(\C)/C=C/[C@@H]([C@@H](C)/C=C/C(=O)O)O)C)O[C@H]1/C=C/C(=C/C(=O)O)/C)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C37H54O11/c1-6-7-8-20-36(48-35(45)18-17-33(41)42)22-23-37(47-31(36)15-11-26(3)24-34(43)44)21-19-28(5)30(46-37)14-10-25(2)9-13-29(38)27(4)12-16-32(39)40/h9-13,15-16,24,27-31,38H,6-8,14,17-23H2,1-5H3,(H,39,40)(H,41,42)(H,43,44)/b13-9+,15-11+,16-12+,25-10+,26-24+/t27-,28-,29-,30+,31-,36+,37-/m0/s1 |
| InChI Key | VYOFNCHDOAZCMT-SFKKXSHQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C37H54O11 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.36661253 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | 6.40 |
| AKOS040755816 |
| Q43578515 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.96% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.62% | 89.63% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.33% | 97.25% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 94.92% | 98.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.22% | 98.95% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 93.92% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.58% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.46% | 96.47% |
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 89.69% | 91.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.44% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.37% | 93.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 88.43% | 99.35% |
| CHEMBL3776 | Q14790 | Caspase-8 | 88.30% | 97.06% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.29% | 92.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.75% | 96.61% |
| CHEMBL1870 | P28702 | Retinoid X receptor beta | 87.74% | 95.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.39% | 86.33% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.36% | 97.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.36% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.35% | 91.19% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.35% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.85% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.72% | 99.23% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.38% | 82.50% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.94% | 97.86% |
| CHEMBL2004 | P48443 | Retinoid X receptor gamma | 81.21% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.49% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.39% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 52914814 |
| LOTUS | LTS0075515 |
| wikiData | Q43578515 |