Rel-Neamphamide C
| Internal ID | cd72ff07-2cec-4ba0-8ef2-512e2df25243 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 3-[(3R,6S,9S,12R,15R,18R,19R,22S)-18-[[5-amino-2-[[(2R,3R,4S)-4-[[(2S)-4-amino-2-[[(2R,3R,4R)-3-hydroxy-2,4,6-trimethylheptanoyl]amino]-4-oxobutanoyl]amino]-7-(diaminomethylideneamino)-2,3-dihydroxyheptanoyl]amino]-3,4-dimethyl-5-oxopentanoyl]amino]-12-[3-(diaminomethylideneamino)propyl]-15-[(1S)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-7,19-dimethyl-9-(2-methylpropyl)-2,5,8,11,14,17,21-heptaoxo-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-6-yl]propanoic acid |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N2CCCCC2C(=O)O1)C(C3=CC=C(C=C3)O)OC)CCC(=O)O)C)CC(C)C)CCCN=C(N)N)C(C)O)NC(=O)C(C(C)C(C)C(=O)N)NC(=O)C(C(C(CCCN=C(N)N)NC(=O)C(CC(=O)N)NC(=O)C(C)C(C(C)CC(C)C)O)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@@H](C(=O)N2CCCC[C@H]2C(=O)O1)[C@@H](C3=CC=C(C=C3)O)OC)CCC(=O)O)C)CC(C)C)CCCN=C(N)N)[C@H](C)O)NC(=O)C(C(C)C(C)C(=O)N)NC(=O)[C@@H]([C@@H]([C@H](CCCN=C(N)N)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](C)[C@@H]([C@H](C)CC(C)C)O)O)O |
| InChI | InChI=1S/C71H118N18O22/c1-32(2)29-34(5)54(95)37(8)59(99)82-44(31-48(72)92)61(101)80-42(17-15-26-78-70(74)75)55(96)56(97)66(106)84-50(35(6)36(7)58(73)98)63(103)86-52-39(10)111-69(109)47-19-13-14-28-89(47)68(108)53(57(110-12)40-20-22-41(91)23-21-40)87-62(102)46(24-25-49(93)94)88(11)67(107)45(30-33(3)4)83-60(100)43(18-16-27-79-71(76)77)81-64(104)51(38(9)90)85-65(52)105/h20-23,32-39,42-47,50-57,90-91,95-97H,13-19,24-31H2,1-12H3,(H2,72,92)(H2,73,98)(H,80,101)(H,81,104)(H,82,99)(H,83,100)(H,84,106)(H,85,105)(H,86,103)(H,87,102)(H,93,94)(H4,74,75,78)(H4,76,77,79)/t34-,35?,36?,37-,38+,39-,42+,43-,44+,45+,46+,47+,50?,51-,52-,53-,54-,55-,56-,57-/m1/s1 |
| InChI Key | BAYIUKNWFJLOEO-SZKMIYDASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C71H118N18O22 |
| Molecular Weight | 1575.80 g/mol |
| Exact Mass | 1574.86680746 g/mol |
| Topological Polar Surface Area (TPSA) | 662.00 Ų |
| XlogP | -3.30 |
| Atomic LogP (AlogP) | -5.46 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 36 |
| CHEMBL2208228 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7800 | 78.00% |
| Caco-2 | - | 0.8602 | 86.02% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.4287 | 42.87% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8060 | 80.60% |
| OATP1B3 inhibitior | + | 0.9284 | 92.84% |
| MATE1 inhibitior | - | 0.7600 | 76.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9398 | 93.98% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8904 | 89.04% |
| CYP3A4 substrate | + | 0.7586 | 75.86% |
| CYP2C9 substrate | - | 0.6059 | 60.59% |
| CYP2D6 substrate | - | 0.8281 | 82.81% |
| CYP3A4 inhibition | - | 0.9318 | 93.18% |
| CYP2C9 inhibition | - | 0.8159 | 81.59% |
| CYP2C19 inhibition | - | 0.8321 | 83.21% |
| CYP2D6 inhibition | - | 0.8827 | 88.27% |
| CYP1A2 inhibition | - | 0.8898 | 88.98% |
| CYP2C8 inhibition | + | 0.8428 | 84.28% |
| CYP inhibitory promiscuity | - | 0.9900 | 99.00% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.6140 | 61.40% |
| Eye corrosion | - | 0.9842 | 98.42% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.7610 | 76.10% |
| Skin corrosion | - | 0.9249 | 92.49% |
| Ames mutagenesis | - | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7156 | 71.56% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | + | 0.5169 | 51.69% |
| skin sensitisation | - | 0.8467 | 84.67% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.6869 | 68.69% |
| Acute Oral Toxicity (c) | III | 0.5329 | 53.29% |
| Estrogen receptor binding | - | 0.5169 | 51.69% |
| Androgen receptor binding | + | 0.7532 | 75.32% |
| Thyroid receptor binding | + | 0.7686 | 76.86% |
| Glucocorticoid receptor binding | + | 0.8306 | 83.06% |
| Aromatase binding | + | 0.8141 | 81.41% |
| PPAR gamma | + | 0.7886 | 78.86% |
| Honey bee toxicity | - | 0.6280 | 62.80% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.8173 | 81.73% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.84% | 96.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.42% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.50% | 91.11% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.12% | 96.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.61% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.69% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.59% | 97.09% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 94.80% | 96.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.73% | 90.71% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 94.72% | 90.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.65% | 95.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.16% | 98.05% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 93.63% | 88.42% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.48% | 85.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.74% | 93.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.20% | 97.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.87% | 94.66% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.13% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.75% | 90.08% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.39% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.34% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.06% | 99.35% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 89.95% | 97.43% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.79% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.74% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.52% | 99.15% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.78% | 95.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.74% | 96.90% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.51% | 98.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.14% | 91.81% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.08% | 93.03% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.01% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.63% | 99.23% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.34% | 89.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.20% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.91% | 86.33% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.70% | 97.31% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.28% | 96.11% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 85.27% | 85.83% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.75% | 85.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.87% | 96.47% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.62% | 94.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.43% | 95.93% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 83.33% | 98.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.04% | 82.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.81% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.76% | 95.89% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.62% | 96.31% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.20% | 92.88% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.76% | 95.56% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 80.21% | 97.64% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.18% | 90.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.06% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71452581 |
| LOTUS | LTS0066797 |
| wikiData | Q104922550 |