Rel-Neamphamide B
| Internal ID | 2d84ed12-a04c-43fb-8b6c-7da427fe68e1 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 4-[[(2R,3R,4S)-4-[[(2S)-4-amino-2-[[(2R,3R,4R)-3-hydroxy-2,4,6-trimethylheptanoyl]amino]-4-oxobutanoyl]amino]-7-(diaminomethylideneamino)-2,3-dihydroxyheptanoyl]amino]-N'-[(3R,6S,9S,12R,15R,18R,19R,22S)-6-(3-amino-3-oxopropyl)-12-[3-(diaminomethylideneamino)propyl]-15-[(1S)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-7,19-dimethyl-9-(2-methylpropyl)-2,5,8,11,14,17,21-heptaoxo-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N2CCCCC2C(=O)O1)C(C3=CC=C(C=C3)O)OC)CCC(=O)N)C)CC(C)C)CCCN=C(N)N)C(C)O)NC(=O)C(C(C)C(C)C(=O)N)NC(=O)C(C(C(CCCN=C(N)N)NC(=O)C(CC(=O)N)NC(=O)C(C)C(C(C)CC(C)C)O)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@@H](C(=O)N2CCCC[C@H]2C(=O)O1)[C@@H](C3=CC=C(C=C3)O)OC)CCC(=O)N)C)CC(C)C)CCCN=C(N)N)[C@H](C)O)NC(=O)C(C(C)C(C)C(=O)N)NC(=O)[C@@H]([C@@H]([C@H](CCCN=C(N)N)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](C)[C@@H]([C@H](C)CC(C)C)O)O)O |
| InChI | InChI=1S/C71H119N19O21/c1-32(2)29-34(5)54(95)37(8)59(99)83-44(31-49(73)94)61(101)81-42(17-15-26-79-70(75)76)55(96)56(97)66(106)85-50(35(6)36(7)58(74)98)63(103)87-52-39(10)111-69(109)47-19-13-14-28-90(47)68(108)53(57(110-12)40-20-22-41(92)23-21-40)88-62(102)46(24-25-48(72)93)89(11)67(107)45(30-33(3)4)84-60(100)43(18-16-27-80-71(77)78)82-64(104)51(38(9)91)86-65(52)105/h20-23,32-39,42-47,50-57,91-92,95-97H,13-19,24-31H2,1-12H3,(H2,72,93)(H2,73,94)(H2,74,98)(H,81,101)(H,82,104)(H,83,99)(H,84,100)(H,85,106)(H,86,105)(H,87,103)(H,88,102)(H4,75,76,79)(H4,77,78,80)/t34-,35?,36?,37-,38+,39-,42+,43-,44+,45+,46+,47+,50?,51-,52-,53-,54-,55-,56-,57-/m1/s1 |
| InChI Key | CTBZWDZNRDQPPS-SZKMIYDASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C71H119N19O21 |
| Molecular Weight | 1574.80 g/mol |
| Exact Mass | 1573.88279188 g/mol |
| Topological Polar Surface Area (TPSA) | 668.00 Ų |
| XlogP | -3.90 |
| Atomic LogP (AlogP) | -6.05 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 36 |
| RefChem:178805 |
| 4-(((2R,3R,4S)-4-(((2S)-4-amino-2-(((2R,3R,4R)-3-hydroxy-2,4,6-trimethylheptanoyl)amino)-4-oxobutanoyl)amino)-7-(diaminomethylideneamino)-2,3-dihydroxyheptanoyl)amino)-N'-((3R,6S,9S,12R,15R,18R,19R,22S)-6-(3-amino-3-oxopropyl)-12-(3-(diaminomethylideneamino)propyl)-15-((1S)-1-hydroxyethyl)-3-((R)-(4-hydroxyphenyl)-methoxymethyl)-7,19-dimethyl-9-(2-methylpropyl)-2,5,8,11,14,17,21-heptaoxo-20-oxa-1,4,7,10,13,16-hexazabicyclo(20.4.0)hexacosan-18-yl)-2,3-dimethylpentanediamide |
| 4-[[(2R,3R,4S)-4-[[(2S)-4-amino-2-[[(2R,3R,4R)-3-hydroxy-2,4,6-trimethylheptanoyl]amino]-4-oxobutanoyl]amino]-7-(diaminomethylideneamino)-2,3-dihydroxyheptanoyl]amino]-N'-[(3R,6S,9S,12R,15R,18R,19R,22S)-6-(3-amino-3-oxopropyl)-12-[3-(diaminomethylideneamino)propyl]-15-[(1S)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-7,19-dimethyl-9-(2-methylpropyl)-2,5,8,11,14,17,21-heptaoxo-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide |
| CHEMBL2208229 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7800 | 78.00% |
| Caco-2 | - | 0.8604 | 86.04% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.4287 | 42.87% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8035 | 80.35% |
| OATP1B3 inhibitior | + | 0.9284 | 92.84% |
| MATE1 inhibitior | - | 0.7200 | 72.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9405 | 94.05% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8911 | 89.11% |
| CYP3A4 substrate | + | 0.7597 | 75.97% |
| CYP2C9 substrate | - | 0.6128 | 61.28% |
| CYP2D6 substrate | - | 0.8120 | 81.20% |
| CYP3A4 inhibition | - | 0.9318 | 93.18% |
| CYP2C9 inhibition | - | 0.8159 | 81.59% |
| CYP2C19 inhibition | - | 0.8321 | 83.21% |
| CYP2D6 inhibition | - | 0.8827 | 88.27% |
| CYP1A2 inhibition | - | 0.8898 | 88.98% |
| CYP2C8 inhibition | + | 0.8420 | 84.20% |
| CYP inhibitory promiscuity | - | 0.9900 | 99.00% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.6140 | 61.40% |
| Eye corrosion | - | 0.9842 | 98.42% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7610 | 76.10% |
| Skin corrosion | - | 0.9249 | 92.49% |
| Ames mutagenesis | - | 0.6000 | 60.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7164 | 71.64% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | + | 0.5169 | 51.69% |
| skin sensitisation | - | 0.8467 | 84.67% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.7593 | 75.93% |
| Acute Oral Toxicity (c) | III | 0.5329 | 53.29% |
| Estrogen receptor binding | - | 0.5000 | 50.00% |
| Androgen receptor binding | + | 0.7544 | 75.44% |
| Thyroid receptor binding | + | 0.7637 | 76.37% |
| Glucocorticoid receptor binding | + | 0.8246 | 82.46% |
| Aromatase binding | + | 0.8135 | 81.35% |
| PPAR gamma | + | 0.7795 | 77.95% |
| Honey bee toxicity | - | 0.6229 | 62.29% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.8173 | 81.73% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.82% | 96.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.72% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.65% | 98.05% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.99% | 96.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.56% | 97.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.61% | 88.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.57% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.16% | 90.71% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 95.03% | 96.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.77% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.83% | 95.56% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.61% | 94.66% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.42% | 90.93% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.97% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.43% | 94.45% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.39% | 97.64% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.20% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.65% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 89.85% | 98.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.84% | 91.81% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.57% | 93.03% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.43% | 98.59% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.36% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.12% | 95.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 89.01% | 96.31% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.22% | 96.11% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.14% | 96.90% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.92% | 99.35% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.91% | 93.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 87.71% | 94.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.17% | 89.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.71% | 99.23% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.68% | 95.93% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.63% | 91.19% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 86.31% | 85.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.98% | 97.14% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.86% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.54% | 98.75% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.15% | 97.31% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.54% | 82.38% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.14% | 95.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.77% | 92.88% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.37% | 99.15% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.19% | 90.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.09% | 95.89% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.04% | 97.64% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.79% | 94.78% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.61% | 89.00% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 82.56% | 97.43% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.55% | 97.25% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.15% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.04% | 86.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.00% | 95.50% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.22% | 85.83% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.92% | 96.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.86% | 100.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 80.76% | 83.14% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 80.20% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71461528 |
| LOTUS | LTS0027856 |
| wikiData | Q104969701 |