Regaloside K
Internal ID | 110e6894-4dfb-4591-8b94-3f17b97f7d07 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols |
IUPAC Name | [(2S)-3-hydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC(CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)OC[C@H](CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
InChI | InChI=1S/C18H24O11/c19-6-10(28-18-17(26)16(25)15(24)13(7-20)29-18)8-27-14(23)4-2-9-1-3-11(21)12(22)5-9/h1-5,10,13,15-22,24-26H,6-8H2/b4-2+/t10-,13+,15+,16-,17+,18+/m0/s1 |
InChI Key | FJDZFTLKTCOXAV-WDYFMUQCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H24O11 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | -1.40 |
HY-N11489 |
CS-0648021 |
138772-00-6 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.31% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.20% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.26% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.49% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.43% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 92.30% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.63% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.20% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.13% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.46% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.41% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.70% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lilium mackliniae |
PubChem | 15101908 |
LOTUS | LTS0043218 |
wikiData | Q104996005 |