Regaloside B
Internal ID | 61721297-4b86-4223-996c-b01802e2016e |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols |
IUPAC Name | [(2S)-3-acetyloxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC(COC(=O)C=CC1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H](COC(=O)/C=C/C1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O |
InChI | InChI=1S/C20H26O11/c1-11(22)28-9-14(30-20-19(27)18(26)17(25)15(8-21)31-20)10-29-16(24)7-4-12-2-5-13(23)6-3-12/h2-7,14-15,17-21,23,25-27H,8-10H2,1H3/b7-4+/t14-,15?,17?,18?,19?,20?/m0/s1 |
InChI Key | YQKQOLPNKNHLBO-KRJCNZRASA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O11 |
Molecular Weight | 442.40 g/mol |
Exact Mass | 442.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | -0.50 |
114420-67-6 |
NSC627041 |
[(2S)-3-acetyloxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
DTXSID20420049 |
NSC-627041 |
D85206 |
![2D Structure of Regaloside B 2D Structure of Regaloside B](https://plantaedb.com/storage/docs/compounds/2023/11/regaloside-b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.02% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.46% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.92% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.67% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.19% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.11% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.75% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.06% | 98.95% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 89.13% | 89.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.19% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.33% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.93% | 97.09% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.52% | 85.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.25% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.76% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lilium auratum |
Lilium brownii |
Lilium mackliniae |
Lilium regale |
PubChem | 5459143 |
LOTUS | LTS0257262 |
wikiData | Q82231306 |