Rancinamycin IIA
| Internal ID | 2132124d-13f2-46a1-a8cd-d1ed4080218c |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
| IUPAC Name | (2-formyl-4,5,6-trihydroxycyclohex-2-en-1-yl) pentanoate |
| SMILES (Canonical) | CCCCC(=O)OC1C(C(C(C=C1C=O)O)O)O |
| SMILES (Isomeric) | CCCCC(=O)OC1C(C(C(C=C1C=O)O)O)O |
| InChI | InChI=1S/C12H18O6/c1-2-3-4-9(15)18-12-7(6-13)5-8(14)10(16)11(12)17/h5-6,8,10-12,14,16-17H,2-4H2,1H3 |
| InChI Key | NSBYSHKEWUPBPX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | -1.00 |
| Rancinamycin II |
| UNII-2Z667N02HQ |
| 2Z667N02HQ |
| 1168139-98-7 |
| Pentanoic acid, 2-formyl-4,5,6-trihydroxy-2-cyclohexen-1-yl ester |
| CHEMBL2105321 |
| SCHEMBL29362144 |
| CHEBI:209052 |
| ZINC04214253 |
| Q27255836 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.38% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.66% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.22% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.39% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.63% | 91.11% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 88.97% | 85.94% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.15% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.36% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.33% | 95.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.30% | 92.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.08% | 97.25% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.93% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 49825770 |
| LOTUS | LTS0126170 |
| wikiData | Q27255836 |