Ranatachykinin C
Internal ID | 4a0e1780-3a95-41d1-9c1f-d66924b59aac |
Taxonomy | Organic Polymers > Polypeptides |
IUPAC Name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S,3S)-1-[[2-[[(2S)-1-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
SMILES (Canonical) | CCC(C)C(C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)N)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CO)NC(=O)C(C)NC(=O)C2CCCN2C(=O)C(CC(=O)N)NC(=O)C(CC3=CN=CN3)N |
SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC3=CN=CN3)N |
InChI | InChI=1S/C49H76N14O12S/c1-7-27(4)40(48(74)54-23-39(66)57-33(18-26(2)3)44(70)58-32(41(52)67)15-17-76-6)62-45(71)34(19-29-12-9-8-10-13-29)59-46(72)36(24-64)61-42(68)28(5)56-47(73)37-14-11-16-63(37)49(75)35(21-38(51)65)60-43(69)31(50)20-30-22-53-25-55-30/h8-10,12-13,22,25-28,31-37,40,64H,7,11,14-21,23-24,50H2,1-6H3,(H2,51,65)(H2,52,67)(H,53,55)(H,54,74)(H,56,73)(H,57,66)(H,58,70)(H,59,72)(H,60,69)(H,61,68)(H,62,71)/t27-,28-,31-,32-,33-,34-,35-,36-,37-,40-/m0/s1 |
InChI Key | LVFJZDFXJABCGT-ZEQGLLOKSA-N |
Popularity | 4 references in papers |
Molecular Formula | C49H76N14O12S |
Molecular Weight | 1085.30 g/mol |
Exact Mass | 1084.54878509 g/mol |
Topological Polar Surface Area (TPSA) | 440.00 Ų |
XlogP | -1.70 |
Atomic LogP (AlogP) | -3.76 |
H-Bond Acceptor | 15 |
H-Bond Donor | 13 |
Rotatable Bonds | 32 |
RTK C |
135690-49-2 |
RTK-C |
His-asn-pro-ala-ser-phe-ile-gly-leu-met-NH2 |
CHEMBL263185 |
Phyllomedusin, 1-L-histidine-4-L-alanine-5-L-serine- |
HisAsnProAlaSerPheIleGlyLeuMet |
BDBM50087852 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9036 | 90.36% |
Caco-2 | - | 0.8715 | 87.15% |
Blood Brain Barrier | - | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Lysosomes | 0.5401 | 54.01% |
OATP2B1 inhibitior | - | 0.8569 | 85.69% |
OATP1B1 inhibitior | + | 0.8162 | 81.62% |
OATP1B3 inhibitior | + | 0.9283 | 92.83% |
MATE1 inhibitior | - | 0.8621 | 86.21% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.9792 | 97.92% |
P-glycoprotein inhibitior | + | 0.7441 | 74.41% |
P-glycoprotein substrate | + | 0.8761 | 87.61% |
CYP3A4 substrate | + | 0.7381 | 73.81% |
CYP2C9 substrate | - | 0.8060 | 80.60% |
CYP2D6 substrate | - | 0.8389 | 83.89% |
CYP3A4 inhibition | - | 0.8424 | 84.24% |
CYP2C9 inhibition | - | 0.8645 | 86.45% |
CYP2C19 inhibition | - | 0.8632 | 86.32% |
CYP2D6 inhibition | - | 0.9125 | 91.25% |
CYP1A2 inhibition | - | 0.9001 | 90.01% |
CYP2C8 inhibition | + | 0.7750 | 77.50% |
CYP inhibitory promiscuity | - | 0.9814 | 98.14% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.7800 | 78.00% |
Carcinogenicity (trinary) | Non-required | 0.6404 | 64.04% |
Eye corrosion | - | 0.9866 | 98.66% |
Eye irritation | - | 0.8984 | 89.84% |
Skin irritation | - | 0.7787 | 77.87% |
Skin corrosion | - | 0.9201 | 92.01% |
Ames mutagenesis | - | 0.7800 | 78.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6812 | 68.12% |
Micronuclear | + | 0.7800 | 78.00% |
Hepatotoxicity | + | 0.5677 | 56.77% |
skin sensitisation | - | 0.8764 | 87.64% |
Respiratory toxicity | + | 0.8444 | 84.44% |
Reproductive toxicity | + | 0.9556 | 95.56% |
Mitochondrial toxicity | + | 0.9125 | 91.25% |
Nephrotoxicity | - | 0.8783 | 87.83% |
Acute Oral Toxicity (c) | III | 0.6400 | 64.00% |
Estrogen receptor binding | + | 0.7513 | 75.13% |
Androgen receptor binding | + | 0.6015 | 60.15% |
Thyroid receptor binding | + | 0.5785 | 57.85% |
Glucocorticoid receptor binding | + | 0.6410 | 64.10% |
Aromatase binding | + | 0.6977 | 69.77% |
PPAR gamma | + | 0.7051 | 70.51% |
Honey bee toxicity | - | 0.7095 | 70.95% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
Fish aquatic toxicity | + | 0.7315 | 73.15% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.99% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 99.97% | 98.95% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.68% | 98.33% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.48% | 97.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.18% | 96.09% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 98.68% | 88.42% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.67% | 97.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.43% | 90.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 98.34% | 90.20% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.17% | 100.00% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.29% | 98.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.57% | 93.56% |
CHEMBL204 | P00734 | Thrombin | 96.47% | 96.01% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.83% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.78% | 97.09% |
CHEMBL236 | P41143 | Delta opioid receptor | 95.23% | 99.35% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.21% | 91.81% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.85% | 96.67% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.42% | 93.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 94.34% | 93.03% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.25% | 98.94% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 93.98% | 93.33% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 93.85% | 97.43% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.53% | 96.03% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.48% | 90.71% |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 92.46% | 95.52% |
CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 92.36% | 99.77% |
CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 92.09% | 92.80% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.69% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.30% | 94.45% |
CHEMBL4801 | P29466 | Caspase-1 | 91.12% | 96.85% |
CHEMBL2535 | P11166 | Glucose transporter | 91.09% | 98.75% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 91.08% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.01% | 97.14% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.81% | 96.67% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 89.73% | 98.89% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 89.73% | 95.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.26% | 95.56% |
CHEMBL3837 | P07711 | Cathepsin L | 88.22% | 96.61% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 86.95% | 99.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.38% | 99.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.35% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.92% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.69% | 91.19% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.92% | 95.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.15% | 96.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.06% | 82.69% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.67% | 82.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.39% | 95.89% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 82.07% | 98.59% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.65% | 89.33% |
CHEMBL2327 | P21452 | Neurokinin 2 receptor | 81.58% | 98.89% |
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 81.33% | 94.55% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.10% | 93.10% |
CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 80.18% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
There are no matching plants. |
PubChem | 9988742 |
LOTUS | LTS0203840 |
wikiData | Q105157829 |