Ralstonin C
| Internal ID | 4c4e2f11-e5b0-4666-aa20-c825a9edabb1 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (Z,2S,3S)-3-amino-2-hydroxy-N-[(2S,3R)-3-hydroxy-1-[[(1S,2S)-1-hydroxy-3-[[(2S)-3-hydroxy-1-[[(2S)-4-hydroxy-1-[[2-[[(7R,16S,19R)-7-methyl-13-methylidene-2,6,9,12,15,18-hexaoxo-16-propan-2-yl-1-oxa-5,8,11,14,17-pentazacyclohenicos-19-yl]amino]-2-oxoethyl]amino]-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-(4-hydroxyphenyl)-3-oxopropan-2-yl]amino]-1-oxobutan-2-yl]icos-13-enamide |
| SMILES (Canonical) | CCCCCCC=CCCCCCCCCCC(C(C(=O)NC(C(C)O)C(=O)NC(C(C1=CC=C(C=C1)O)O)C(=O)NC(CO)C(=O)NC(CCO)C(=O)NCC(=O)NC2CCOC(=O)CCNC(=O)C(NC(=O)CNC(=O)C(=C)NC(=O)C(NC2=O)C(C)C)C)O)N |
| SMILES (Isomeric) | CCCCCC/C=C\CCCCCCCCC[C@@H]([C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@H](C1=CC=C(C=C1)O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCO)C(=O)NCC(=O)N[C@@H]2CCOC(=O)CCNC(=O)[C@H](NC(=O)CNC(=O)C(=C)NC(=O)[C@@H](NC2=O)C(C)C)C)O)N |
| InChI | InChI=1S/C62H100N12O19/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-42(63)53(83)62(92)73-50(39(6)77)60(90)74-51(52(82)40-23-25-41(78)26-24-40)61(91)71-45(35-76)58(88)70-43(28-31-75)56(86)66-34-47(80)69-44-29-32-93-48(81)27-30-64-54(84)37(4)67-46(79)33-65-55(85)38(5)68-59(89)49(36(2)3)72-57(44)87/h12-13,23-26,36-37,39,42-45,49-53,75-78,82-83H,5,7-11,14-22,27-35,63H2,1-4,6H3,(H,64,84)(H,65,85)(H,66,86)(H,67,79)(H,68,89)(H,69,80)(H,70,88)(H,71,91)(H,72,87)(H,73,92)(H,74,90)/b13-12-/t37-,39-,42+,43+,44-,45+,49+,50+,51+,52+,53+/m1/s1 |
| InChI Key | CDVJNSDMXJSROS-QWUKGXDJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C62H100N12O19 |
| Molecular Weight | 1317.50 g/mol |
| Exact Mass | 1316.72276901 g/mol |
| Topological Polar Surface Area (TPSA) | 494.00 Ų |
| XlogP | 1.20 |
| Atomic LogP (AlogP) | -2.71 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 35 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7063 | 70.63% |
| Caco-2 | - | 0.8617 | 86.17% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.5279 | 52.79% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7996 | 79.96% |
| OATP1B3 inhibitior | + | 0.9139 | 91.39% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9259 | 92.59% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8615 | 86.15% |
| CYP3A4 substrate | + | 0.7456 | 74.56% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8243 | 82.43% |
| CYP3A4 inhibition | + | 0.7123 | 71.23% |
| CYP2C9 inhibition | - | 0.8807 | 88.07% |
| CYP2C19 inhibition | - | 0.8611 | 86.11% |
| CYP2D6 inhibition | - | 0.8938 | 89.38% |
| CYP1A2 inhibition | - | 0.8699 | 86.99% |
| CYP2C8 inhibition | + | 0.8281 | 82.81% |
| CYP inhibitory promiscuity | - | 0.9541 | 95.41% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5781 | 57.81% |
| Eye corrosion | - | 0.9847 | 98.47% |
| Eye irritation | - | 0.8961 | 89.61% |
| Skin irritation | - | 0.7561 | 75.61% |
| Skin corrosion | - | 0.9233 | 92.33% |
| Ames mutagenesis | - | 0.7600 | 76.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7196 | 71.96% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | - | 0.5394 | 53.94% |
| skin sensitisation | - | 0.8376 | 83.76% |
| Respiratory toxicity | + | 0.7556 | 75.56% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.6135 | 61.35% |
| Acute Oral Toxicity (c) | III | 0.6686 | 66.86% |
| Estrogen receptor binding | + | 0.6023 | 60.23% |
| Androgen receptor binding | + | 0.7380 | 73.80% |
| Thyroid receptor binding | + | 0.6368 | 63.68% |
| Glucocorticoid receptor binding | + | 0.7341 | 73.41% |
| Aromatase binding | + | 0.7395 | 73.95% |
| PPAR gamma | + | 0.7493 | 74.93% |
| Honey bee toxicity | - | 0.6835 | 68.35% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5288 | 52.88% |
| Fish aquatic toxicity | + | 0.9444 | 94.44% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.73% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.49% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.17% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.92% | 93.10% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.86% | 90.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.61% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.56% | 99.17% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 97.16% | 94.66% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 97.08% | 98.03% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 96.75% | 92.88% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.95% | 95.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.80% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.54% | 94.75% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 94.50% | 89.67% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 94.36% | 88.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.88% | 89.63% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.62% | 99.35% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 93.37% | 92.97% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.55% | 100.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 92.43% | 89.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.20% | 95.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.07% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.91% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.85% | 93.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.71% | 97.79% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.42% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.27% | 95.71% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.75% | 88.42% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.19% | 83.10% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.26% | 96.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.73% | 90.71% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.99% | 97.29% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.77% | 98.59% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.10% | 91.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.98% | 96.90% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.80% | 96.67% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 85.77% | 98.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.77% | 95.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.74% | 90.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.63% | 97.14% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.53% | 96.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.37% | 95.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.14% | 91.81% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.51% | 96.11% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 83.89% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.80% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.44% | 95.93% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.98% | 91.71% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.85% | 96.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.70% | 97.64% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.56% | 94.33% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.54% | 97.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.45% | 95.83% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.14% | 80.71% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.65% | 90.20% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.62% | 85.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.49% | 93.18% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.05% | 98.57% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.44% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.36% | 99.23% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 80.04% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682339 |
| LOTUS | LTS0124918 |
| wikiData | Q104955231 |