Radarin D
| Internal ID | 7ed81822-465d-4fec-982e-680248554646 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | (1R,2S,4aS,4bR,7R,8S,8aR,10aS)-8-(1H-indol-3-ylmethyl)-1,4b,7,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-2-ol |
| SMILES (Canonical) | CC1CCC2(C3CCC(C(C3(CCC2C1(C)CC4=CNC5=CC=CC=C54)C)C)O)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@]2([C@@H]3CC[C@@H]([C@@H]([C@]3(CC[C@@H]2[C@@]1(C)CC4=CNC5=CC=CC=C54)C)C)O)C |
| InChI | InChI=1S/C28H41NO/c1-18-12-14-27(4)24-11-10-23(30)19(2)26(24,3)15-13-25(27)28(18,5)16-20-17-29-22-9-7-6-8-21(20)22/h6-9,17-19,23-25,29-30H,10-16H2,1-5H3/t18-,19+,23+,24-,25+,26-,27+,28+/m1/s1 |
| InChI Key | AOYNVKNXGQEQEA-MEZXNFOZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.318814931 g/mol |
| Topological Polar Surface Area (TPSA) | 36.00 Ų |
| XlogP | 8.00 |
| SCHEMBL9595870 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.95% | 88.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.39% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.61% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.55% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.34% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.81% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.43% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.32% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.69% | 97.79% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.37% | 94.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.34% | 92.62% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.21% | 95.00% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 86.61% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.49% | 90.08% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 86.20% | 95.92% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.68% | 95.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.32% | 97.64% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.21% | 85.49% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.65% | 82.69% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.54% | 89.00% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.74% | 95.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.10% | 97.50% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.42% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21610068 |
| LOTUS | LTS0075851 |
| wikiData | Q75055198 |