(R,2S,3R,6S,9S,10S)-bromo-2,9,10-trimethyl-7-methylidene-octahydro-1H-2,4a-methanonapthalen-1-one
| Internal ID | 4a38383d-180b-4e2a-a6e6-7ca859647be4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids |
| IUPAC Name | (R,2S,3R,6S,9S,10S)-bromo-2,9,10-trimethyl-7-methylidene-octahydro-1H-2,4a-methanonapthalen-1-one |
| SMILES (Canonical) | CC1C(C(=O)C(C23C1(CC(C2=C)CC3)C)C)Br |
| SMILES (Isomeric) | C[C@@H]1[C@H](C(=O)[C@H]([C@@]23[C@]1(C[C@@H](C2=C)CC3)C)C)Br |
| InChI | InChI=1S/C15H21BrO/c1-8-11-5-6-15(8)10(3)13(17)12(16)9(2)14(15,4)7-11/h9-12H,1,5-7H2,2-4H3/t9-,10-,11+,12-,14+,15+/m1/s1 |
| InChI Key | XZRLMXNBJHJEMX-FYPHCDFOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.07758 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.57% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.66% | 96.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 88.76% | 95.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.74% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.39% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.58% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.48% | 96.43% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.14% | 97.25% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.65% | 96.38% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.32% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.87% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.10% | 97.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.02% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.33% | 90.17% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.28% | 95.38% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.45% | 92.94% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.34% | 90.08% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.99% | 96.77% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.22% | 97.05% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.04% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162996592 |
| LOTUS | LTS0215773 |
| wikiData | Q105345125 |