(R)-Pronuciferine
| Internal ID | 0b8b8299-b86e-4ecd-ad20-8076681d8c87 |
| Taxonomy | Alkaloids and derivatives > Proaporphines |
| IUPAC Name | 10,11-dimethoxy-5-methylspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| InChI | InChI=1S/C19H21NO3/c1-20-9-6-12-10-15(22-2)18(23-3)17-16(12)14(20)11-19(17)7-4-13(21)5-8-19/h4-5,7-8,10,14H,6,9,11H2,1-3H3 |
| InChI Key | WUYQEGNOQLRQAQ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.15214353 g/mol |
| Topological Polar Surface Area (TPSA) | 38.80 Ų |
| XlogP | 2.50 |
| (R)-Pronuciferine |
| [8'aR,(+)]-2',3',8',8'a-Tetrahydro-5',6'-dimethoxy-1'-methylspiro[2,5-cyclohexadiene-1,7'(1'H)-cyclopenta[ij]isoquinoline]-4-one |
| 5',6'-dimethoxy-1'-methyl-2',3',8',8a'-tetrahydro-1'H,4H-spiro[cyclohexa-2,5-diene-1,7'-cyclopenta[ij]isoquinolin]-4-one |
| ChemDiv2_002092 |
| SCHEMBL2684479 |
| DTXSID201106774 |
| HMS1374P02 |
| AKOS000732402 |
| AKOS022011456 |
| CCG-119547 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.50% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.21% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.09% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.01% | 93.40% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 92.23% | 91.03% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.02% | 96.77% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.59% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.17% | 91.00% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 88.87% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.38% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.31% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.44% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.91% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.74% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.20% | 95.89% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.54% | 82.38% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.45% | 97.14% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.41% | 96.43% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.73% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.71% | 98.95% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.54% | 92.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.41% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.04% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.42% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona cherimola |
| Berberis montana |
| Berberis sibirica |
| Caryomene olivascens |
| Cissampelos capensis |
| Croton bonplandianus |
| Hypserpa nitida |
| Nelumbo nucifera |
| PubChem | 628376 |
| LOTUS | LTS0272760 |
| wikiData | Q105313394 |