(R)-alternariphent A
Internal ID | c9789ce0-4488-4f7e-a07f-e2cd69b3493c |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | (5R)-5-hydroxy-2-(3-hydroxy-5-methoxyphenyl)-3-methylcyclopent-2-en-1-one |
SMILES (Canonical) | CC1=C(C(=O)C(C1)O)C2=CC(=CC(=C2)OC)O |
SMILES (Isomeric) | CC1=C(C(=O)[C@@H](C1)O)C2=CC(=CC(=C2)OC)O |
InChI | InChI=1S/C13H14O4/c1-7-3-11(15)13(16)12(7)8-4-9(14)6-10(5-8)17-2/h4-6,11,14-15H,3H2,1-2H3/t11-/m1/s1 |
InChI Key | CWLFWIXNLVDJJO-LLVKDONJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H14O4 |
Molecular Weight | 234.25 g/mol |
Exact Mass | 234.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 1.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.89% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.59% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.99% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.74% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.42% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.25% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.42% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.67% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.78% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.00% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 83.66% | 98.75% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 82.75% | 96.12% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.54% | 92.68% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.25% | 93.40% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.17% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.97% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
There are no matching plants. |
PubChem | 139590696 |
LOTUS | LTS0192286 |
wikiData | Q104971340 |