Qujvlurirpuwbr-ifwuamlasa-
Internal ID | 4f6e8892-affd-442b-96e3-8589546b81eb |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [(2S,3R,4R,5R,6S)-4-hydroxy-6-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-2-methyloxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC=C(C=C6)O)O)OC(=O)C=CC7=CC=C(C=C7)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)OC(=O)/C=C/C6=CC=C(C=C6)O)O)OC(=O)/C=C/C7=CC=C(C=C7)O |
InChI | InChI=1S/C39H44O18/c1-18-32(53-25(44)12-6-19-2-8-21(42)9-3-19)31(49)34(54-26(45)13-7-20-4-10-22(43)11-5-20)38(51-18)55-33-23-14-15-50-36(27(23)39(17-41)35(33)57-39)56-37-30(48)29(47)28(46)24(16-40)52-37/h2-15,18,23-24,27-38,40-43,46-49H,16-17H2,1H3/b12-6+,13-7+/t18-,23+,24+,27+,28+,29-,30+,31+,32-,33-,34+,35-,36-,37-,38-,39+/m0/s1 |
InChI Key | QUJVLURIRPUWBR-IFWUAMLASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H44O18 |
Molecular Weight | 800.80 g/mol |
Exact Mass | 800.25276455 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 0.30 |
InChI=1/C39H44O18/c1-18-32(53-25(44)12-6-19-2-8-21(42)9-3-19)31(49)34(54-26(45)13-7-20-4-10-22(43)11-5-20)38(51-18)55-33-23-14-15-50-36(27(23)39(17-41)35(33)57-39)56-37-30(48)29(47)28(46)24(16-40)52-37/h2-15,18,23-24,27-38,40-43,46-49H,16-17H2,1H3/b12-6+, |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.88% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.25% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.43% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.75% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.23% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.51% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 87.97% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.69% | 94.73% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.89% | 89.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.58% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.38% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.44% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.92% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.58% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.41% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 80.81% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gmelina arborea |
PubChem | 21635728 |
LOTUS | LTS0137841 |
wikiData | Q105228231 |