CID 458034
| Internal ID | 7b6314b4-5d78-4f9f-a2a6-bfd59c5516e3 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | N-[(1R,4R,7R,11S,14R,17R,20R,24S)-2,4,12,15,17,25-hexamethyl-27-methylsulfanyl-3,6,10,13,16,19,23,26-octaoxo-11,24-di(propan-2-yl)-20-(quinoxaline-2-carbonylamino)-9,22-dioxa-28-thia-2,5,12,15,18,25-hexazabicyclo[12.12.3]nonacosan-7-yl]quinoxaline-2-carboxamide |
| SMILES (Canonical) | CC1C(=O)N(C2CSC(C(C(=O)N(C(C(=O)OCC(C(=O)N1)NC(=O)C3=NC4=CC=CC=C4N=C3)C(C)C)C)N(C(=O)C(NC(=O)C(COC(=O)C(N(C2=O)C)C(C)C)NC(=O)C5=NC6=CC=CC=C6N=C5)C)C)SC)C |
| SMILES (Isomeric) | C[C@@H]1C(=O)N([C@H]2CSC([C@@H](C(=O)N([C@H](C(=O)OC[C@H](C(=O)N1)NC(=O)C3=NC4=CC=CC=C4N=C3)C(C)C)C)N(C(=O)[C@H](NC(=O)[C@@H](COC(=O)[C@@H](N(C2=O)C)C(C)C)NC(=O)C5=NC6=CC=CC=C6N=C5)C)C)SC)C |
| InChI | InChI=1S/C51H64N12O12S2/c1-25(2)38-49(72)74-22-36(59-42(65)34-21-53-30-17-13-15-19-32(30)57-34)44(67)55-28(6)46(69)63(10)40-48(71)62(9)39(26(3)4)50(73)75-23-35(58-41(64)33-20-52-29-16-12-14-18-31(29)56-33)43(66)54-27(5)45(68)60(7)37(47(70)61(38)8)24-77-51(40)76-11/h12-21,25-28,35-40,51H,22-24H2,1-11H3,(H,54,66)(H,55,67)(H,58,64)(H,59,65)/t27-,28-,35-,36-,37+,38+,39+,40-,51?/m1/s1 |
| InChI Key | AUJXLBOHYWTPFV-CVLRASHMSA-N |
| Popularity | 211 references in papers |
| Molecular Formula | C51H64N12O12S2 |
| Molecular Weight | 1101.30 g/mol |
| Exact Mass | 1100.42080787 g/mol |
| Topological Polar Surface Area (TPSA) | 352.00 Ų |
| XlogP | 2.70 |
| Quinomycin A |
| S-426-S (Lepetit) |
| Echinomycin A |
| 512-64-1 |
| N-[(11S,24S,1R,4R,7R,14R,17R,20R)-2,5,12,15,18,25-hexaaza-11,24-bis(methylethyl)-2,4,12,15,17,25-hexamethyl-27-methylthio-9,22-dioxa-3,6,10,13,16,19,23,26-octaoxo-20-(quinoxalin-2-ylcarbonylamino)-28-thiabicyclo[12.12.3]nonacos-7-yl]quinoxalin-2-ylcarboxamide |
| N-[(1R,4R,7R,11S,14R,17R,20R,24S)-11,24-diisopropyl-2,4,12,15,17,25-hexamethyl-29-methylsulfanyl-3,6,10,13,16,19,23,26-octaoxo-7-(quinoxaline-2-carbonylamino)-9,22-dioxa-28-thia-2,5,12,15,18,25-hexazabicyclo[12.12.3]nonacosan-20-yl]quinoxaline-2-carboxamide |
| N-[(1R,4R,7R,11S,14R,17R,20R,24S)-2,4,12,15,17,25-Hexamethyl-27-methylsulfanyl-3,6,10,13,16,19,23,26-octaoxo-11,24-di(propan-2-yl)-20-(quinoxaline-2-carbonylamino)-9,22-dioxa-28-thia-2,5,12,15,18,25-hexazabicyclo[12.12.3]nonacosan-7-yl]quinoxaline-2-carboxamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.62% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.13% | 99.23% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.35% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.69% | 98.95% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.79% | 81.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.60% | 95.56% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.61% | 88.42% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.99% | 90.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.45% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.76% | 90.71% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.72% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.51% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.33% | 89.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.10% | 88.56% |
| CHEMBL5028 | O14672 | ADAM10 | 82.38% | 97.50% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 82.12% | 95.71% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.12% | 95.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.46% | 98.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.10% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 458034 |
| LOTUS | LTS0106429 |
| wikiData | Q104918976 |