Quinolinic acid
| Internal ID | 82d614e8-a11b-46ba-b474-c83893157f7a |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | pyridine-2,3-dicarboxylic acid |
| SMILES (Canonical) | C1=CC(=C(N=C1)C(=O)O)C(=O)O |
| SMILES (Isomeric) | C1=CC(=C(N=C1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChI Key | GJAWHXHKYYXBSV-UHFFFAOYSA-N |
| Popularity | 5,256 references in papers |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02185764 g/mol |
| Topological Polar Surface Area (TPSA) | 87.50 Ų |
| XlogP | 0.20 |
| Pyridine-2,3-dicarboxylic acid |
| 89-00-9 |
| 2,3-pyridinedicarboxylic acid |
| quinolinate |
| 339155-13-4 |
| Pyridine-2,3-dicarboxylate |
| pyridinedicarboxylic acid |
| AI3-63017 |
| C7H5NO4 |
| pyridine-2,3-carboxylate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
891.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.41% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 94.77% | 87.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.20% | 96.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.55% | 93.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 86.43% | 96.47% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.98% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.17% | 94.42% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.90% | 94.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.50% | 98.95% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 81.81% | 95.72% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.80% | 90.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.55% | 93.04% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.53% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 1066 |
| LOTUS | LTS0238452 |
| wikiData | Q411945 |