Quercetin 4'-isobutyrate
Internal ID | 27a742be-6168-45dc-9e19-1a71d9c4280f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | [2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl] 2-methylpropanoate |
SMILES (Canonical) | CC(C)C(=O)OC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
SMILES (Isomeric) | CC(C)C(=O)OC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
InChI | InChI=1S/C19H16O8/c1-8(2)19(25)27-13-4-3-9(5-11(13)21)18-17(24)16(23)15-12(22)6-10(20)7-14(15)26-18/h3-8,20-22,24H,1-2H3 |
InChI Key | RTGAIXBQQQCKJM-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H16O8 |
Molecular Weight | 372.30 g/mol |
Exact Mass | 372.08451746 g/mol |
Topological Polar Surface Area (TPSA) | 134.00 Ų |
XlogP | 2.70 |
LMPK12112302 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.36% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.13% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.80% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 95.58% | 96.12% |
CHEMBL3194 | P02766 | Transthyretin | 94.57% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.25% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.25% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.99% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.94% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.93% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.84% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.19% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.03% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.84% | 95.78% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.73% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.27% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.43% | 95.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.38% | 99.23% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.15% | 93.65% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.00% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Traversia baccharoides |
PubChem | 44259328 |
LOTUS | LTS0134058 |
wikiData | Q105245128 |