Pyrisulfoxin B
| Internal ID | ad8a1263-3ac5-49d3-8ca2-9b4afa1d1eed |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
| IUPAC Name | 4-methoxy-3-methylsulfinyl-6-pyridin-2-ylpyridine-2-carbonitrile |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H11N3O2S/c1-18-12-7-10(9-5-3-4-6-15-9)16-11(8-14)13(12)19(2)17/h3-7H,1-2H3 |
| InChI Key | CEEFKOCHZZDNPV-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05719778 g/mol |
| Topological Polar Surface Area (TPSA) | 95.10 Ų |
| XlogP | 0.60 |
| 4-Methoxy-3-methylsulfinyl-6-pyridin-2-ylpyridine-2-carbonitrile |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.99% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.66% | 98.75% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 93.31% | 97.53% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.40% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.29% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.91% | 96.00% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 88.94% | 92.51% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.82% | 90.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 86.42% | 92.97% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.39% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.87% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.83% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.87% | 99.17% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.82% | 82.38% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.48% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10265301 |
| LOTUS | LTS0099742 |
| wikiData | Q77491589 |