Pyridine, 1-acetyl-1,2,3,4-tetrahydro-5-(2-piperidinyl)-
| Internal ID | 682bc58f-d065-47be-876c-e479c8921118 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Hydropyridines > Tetrahydropyridines |
| IUPAC Name | 1-(5-piperidin-2-yl-3,4-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES (Canonical) | CC(=O)N1CCCC(=C1)C2CCCCN2 |
| SMILES (Isomeric) | CC(=O)N1CCCC(=C1)C2CCCCN2 |
| InChI | InChI=1S/C12H20N2O/c1-10(15)14-8-4-5-11(9-14)12-6-2-3-7-13-12/h9,12-13H,2-8H2,1H3 |
| InChI Key | APKLQIQRPUDADG-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.157563266 g/mol |
| Topological Polar Surface Area (TPSA) | 32.30 Ų |
| XlogP | 0.30 |
| APKLQIQRPUDADG-UHFFFAOYSA-N |
| Pyridine, 1-acetyl-1,2,3,4-tetrahydro-5-(2-piperidinyl)- |
| 1-Acetyl-5-(2-piperidinyl)-1,2,3,4-tetrahydropyridine # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.35% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.30% | 94.45% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.59% | 93.03% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.60% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.51% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.74% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.94% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.04% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.99% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.71% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ammodendron conollyi |
| Ammodendron karelinii |
| Lupinus angustifolius |
| Lupinus arboreus |
| Lupinus pilosus |
| Maackia amurensis |
| Sophora chrysophylla |
| Sophora mollis |
| PubChem | 108191 |
| LOTUS | LTS0178243 |
| wikiData | Q104916379 |