Pyramidamycin B
| Internal ID | db6a159e-d9a6-458d-be8a-073dc640cfb9 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Salicylic acid and derivatives > Salicylamides |
| IUPAC Name | 2,4-dihydroxy-3-methoxybenzamide |
| SMILES (Canonical) | COC1=C(C=CC(=C1O)C(=O)N)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1O)C(=O)N)O |
| InChI | InChI=1S/C8H9NO4/c1-13-7-5(10)3-2-4(6(7)11)8(9)12/h2-3,10-11H,1H3,(H2,9,12) |
| InChI Key | MNWIPCLNYWQUBM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05315777 g/mol |
| Topological Polar Surface Area (TPSA) | 92.80 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.81% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.73% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.86% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.62% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.97% | 98.75% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 82.68% | 94.05% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.83% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71482611 |
| LOTUS | LTS0028346 |
| wikiData | Q75052857 |