Pvlvgavxxnmxpt-uhfffaoysa-
| Internal ID | 92e49b8d-44f0-4d3a-bc99-3f0a30a08e63 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines |
| IUPAC Name | 4-(hydroxymethyl)-3-methoxy-1-methylbenzo[g]quinoline-2,5,10-trione |
| SMILES (Canonical) | CN1C2=C(C(=C(C1=O)OC)CO)C(=O)C3=CC=CC=C3C2=O |
| SMILES (Isomeric) | CN1C2=C(C(=C(C1=O)OC)CO)C(=O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C16H13NO5/c1-17-12-11(10(7-18)15(22-2)16(17)21)13(19)8-5-3-4-6-9(8)14(12)20/h3-6,18H,7H2,1-2H3 |
| InChI Key | PVLVGAVXXNMXPT-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 83.90 Ų |
| XlogP | 0.10 |
| CHEMBL480651 |
| PVLVGAVXXNMXPT-UHFFFAOYSA- |
| InChI=1/C16H13NO5/c1-17-12-11(10(7-18)15(22-2)16(17)21)13(19)8-5-3-4-6-9(8)14(12)20/h3-6,18H,7H2,1-2H3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.71% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.36% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.12% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.19% | 86.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.14% | 95.93% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.04% | 82.69% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.45% | 96.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.22% | 96.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.62% | 86.92% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.32% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.05% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Goniothalamus tamirensis |
| PubChem | 11779478 |
| LOTUS | LTS0084975 |
| wikiData | Q105215509 |