Purgin III
Internal ID | 86854e69-8e44-488f-bbdc-bcb7c0ba28f9 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4R,5R,6S)-6-[(2S,3S,4R,5R,6S)-5-decanoyloxy-3-[(2S,3R,4S,5S,6S)-5-hexanoyloxy-3-hydroxy-6-methyl-4-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-2-methyl-6-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25S,26S)-7,25,26-trihydroxy-24-(hydroxymethyl)-5-methyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (11S)-11-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5R,6S)-5-[(2S,3R,4R,5S,6S)-3-decanoyloxy-5-[(2S,3R,4S,5S,6S)-5-hexanoyloxy-3-hydroxy-6-methyl-4-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexadecanoate |
SMILES (Canonical) | CCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2O)OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)CO)O)O)CCCCC)C)C)OC5C(C(C(C(O5)C)OC(=O)CCCCC)OC(=O)C=CC6=CC=CC=C6)O)OC7C(C(C(C(O7)CO)OC(=O)CCCCCCCCCC(CCCCC)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)C)OC1C(C(C(C(O1)C)OC1C(C(C(C(O1)C)OC(=O)CCCCC)OC(=O)C=CC1=CC=CC=C1)O)OC1C(C(C(C(O1)CO)O)O)O)OC(=O)CCCCCCCCC)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2O)OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@@H]([C@H](O4)CO)O)O)CCCCC)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC(=O)CCCCC)OC(=O)/C=C/C6=CC=CC=C6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)OC(=O)CCCCCCCCC[C@H](CCCCC)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)OC(=O)/C=C/C1=CC=CC=C1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC(=O)CCCCCCCCC)O)O)O)O |
InChI | InChI=1S/C142H228O54/c1-13-19-25-27-31-39-57-71-99(151)187-131-129(195-134-111(163)106(158)103(155)91(77-143)177-134)121(191-136-115(167)124(184-101(153)75-73-87-59-49-43-50-60-87)119(83(9)170-136)181-95(147)67-47-23-17-5)85(11)173-141(131)189-117-81(7)169-133(112(164)109(117)161)193-126-107(159)104(156)92(78-144)178-139(126)175-89(63-45-21-15-3)65-53-37-33-29-35-41-55-69-97(149)183-123-94(80-146)180-135(113(165)110(123)162)196-130-122(192-137-116(168)125(185-102(154)76-74-88-61-51-44-52-62-88)120(84(10)171-137)182-96(148)68-48-24-18-6)86(12)174-142(132(130)188-100(152)72-58-40-32-28-26-20-14-2)190-118-82(8)172-138-128(114(118)166)186-98(150)70-56-42-36-30-34-38-54-66-90(64-46-22-16-4)176-140-127(194-138)108(160)105(157)93(79-145)179-140/h43-44,49-52,59-62,73-76,81-86,89-94,103-146,155-168H,13-42,45-48,53-58,63-72,77-80H2,1-12H3/b75-73+,76-74+/t81-,82-,83-,84-,85-,86-,89-,90-,91+,92+,93+,94+,103+,104+,105+,106-,107-,108-,109-,110+,111+,112+,113+,114+,115+,116+,117-,118-,119-,120-,121-,122-,123+,124-,125-,126+,127+,128+,129+,130+,131+,132+,133-,134-,135-,136-,137-,138-,139+,140+,141-,142-/m0/s1 |
InChI Key | RIGNHXXJJDXLEF-COBCPTSWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C142H228O54 |
Molecular Weight | 2799.30 g/mol |
Exact Mass | 2798.5128515 g/mol |
Topological Polar Surface Area (TPSA) | 759.00 Ų |
XlogP | 18.10 |
CHEMBL2336637 |
![2D Structure of Purgin III 2D Structure of Purgin III](https://plantaedb.com/storage/docs/compounds/2023/11/purgin-iii.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.47% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.60% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.09% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.08% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.99% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.67% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.47% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 94.48% | 92.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.00% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.46% | 100.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.30% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.90% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.86% | 93.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.84% | 95.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.43% | 94.08% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.30% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.99% | 94.73% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 90.86% | 92.97% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.47% | 91.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.85% | 100.00% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 86.63% | 96.25% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.31% | 96.47% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.27% | 96.37% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.93% | 99.23% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.01% | 92.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.91% | 94.62% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.27% | 85.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.98% | 92.62% |
CHEMBL5028 | O14672 | ADAM10 | 81.90% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.31% | 97.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.11% | 94.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea purga |
PubChem | 71720092 |
LOTUS | LTS0199404 |
wikiData | Q105236841 |