Purgin I
Internal ID | ccb72a7a-a426-4324-b27c-0eaa016f00fe |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4R,5R,6S)-6-[(2S,3S,4R,5R,6S)-5-dodecanoyloxy-3-[(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxy-3-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-2-methyl-6-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (11S)-11-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6S)-5-[(2S,3R,4R,5S,6S)-3-dodecanoyloxy-5-[(2S,3R,4S,5S,6S)-3-hydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxy-4-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC(C(C2O)O)OC3C(C(C(OC3OC(CCCCC)CCCCCCCCCC(=O)OC4C(OC(C(C4O)O)OC5C(C(OC(C5OC(=O)CCCCCCCCCCC)OC6C(OC7C(C6O)OC(=O)CCCCCCCCCC(OC8C(O7)C(C(C(O8)C)O)O)CCCCC)C)C)OC9C(C(C(C(O9)C)OC(=O)C(C)CC)O)OC(=O)C=CC1=CC=CC=C1)CO)C)O)O)C)C)OC1C(C(C(C(O1)C)OC(=O)C(C)CC)OC(=O)C=CC1=CC=CC=C1)O)OC1C(C(C(C(O1)CO)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@H]([C@@H]([C@@H]2O)O)O[C@@H]3[C@H]([C@H]([C@H](O[C@H]3O[C@@H](CCCCC)CCCCCCCCCC(=O)O[C@@H]4[C@H](O[C@H]([C@@H]([C@H]4O)O)O[C@@H]5[C@H]([C@@H](O[C@H]([C@@H]5OC(=O)CCCCCCCCCCC)O[C@H]6[C@@H](O[C@@H]7[C@@H]([C@@H]6O)OC(=O)CCCCCCCCC[C@@H](O[C@H]8[C@H](O7)[C@H]([C@H]([C@H](O8)C)O)O)CCCCC)C)C)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)OC(=O)[C@@H](C)CC)O)OC(=O)/C=C/C1=CC=CC=C1)CO)C)O)O)C)C)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)[C@@H](C)CC)OC(=O)/C=C/C1=CC=CC=C1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
InChI | InChI=1S/C144H232O52/c1-17-23-27-29-31-33-39-45-61-73-99(149)185-131-129(195-136-111(161)106(156)105(155)95(79-145)179-136)121(191-138-116(166)124(120(88(14)172-138)188-134(168)82(8)22-6)182-101(151)77-75-91-63-53-49-54-64-91)89(15)175-143(131)189-117-85(11)171-135(112(162)109(117)159)193-125-107(157)103(153)83(9)169-139(125)177-93(67-51-25-19-3)69-57-43-37-35-41-47-59-71-97(147)181-123-96(80-146)180-137(113(163)110(123)160)196-130-122(192-141-127(184-102(152)78-76-92-65-55-50-56-66-92)114(164)118(86(12)173-141)187-133(167)81(7)21-5)90(16)176-144(132(130)186-100(150)74-62-46-40-34-32-30-28-24-18-2)190-119-87(13)174-142-128(115(119)165)183-98(148)72-60-48-42-36-38-44-58-70-94(68-52-26-20-4)178-140-126(194-142)108(158)104(154)84(10)170-140/h49-50,53-56,63-66,75-78,81-90,93-96,103-132,135-146,153-166H,17-48,51-52,57-62,67-74,79-80H2,1-16H3/b77-75+,78-76+/t81-,82-,83+,84+,85-,86-,87-,88-,89-,90-,93-,94-,95+,96+,103-,104-,105+,106-,107-,108-,109-,110+,111+,112+,113+,114+,115+,116+,117-,118-,119-,120-,121-,122-,123+,124-,125+,126+,127+,128+,129+,130+,131+,132+,135-,136-,137-,138-,139-,140-,141-,142-,143-,144-/m0/s1 |
InChI Key | FQYZTZXSIFWAPT-NMRWSHIASA-N |
Popularity | 2 references in papers |
Molecular Formula | C144H232O52 |
Molecular Weight | 2795.30 g/mol |
Exact Mass | 2794.5543224 g/mol |
Topological Polar Surface Area (TPSA) | 719.00 Ų |
XlogP | 20.20 |
Purgin I |
CHEMBL2336642 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.58% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.56% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.70% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.32% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.17% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.02% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.27% | 92.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.25% | 89.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 93.92% | 92.97% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.80% | 83.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.54% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.68% | 93.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.97% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.49% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.43% | 97.79% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.15% | 94.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.04% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.88% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.48% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.34% | 91.71% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.10% | 96.47% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.07% | 96.37% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.70% | 85.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.53% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.29% | 99.23% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.66% | 96.25% |
CHEMBL5028 | O14672 | ADAM10 | 83.36% | 97.50% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 83.22% | 92.12% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.13% | 91.49% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.38% | 95.92% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.77% | 92.08% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.50% | 97.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.81% | 95.89% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.08% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea purga |
PubChem | 53355581 |
LOTUS | LTS0078977 |
wikiData | Q27136049 |