Ptilocaulin
| Internal ID | dfeebd1d-89e5-400c-9270-96d4a3bef26b |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | (1S,4S,10S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine |
| SMILES (Canonical) | CCCCC1=C2C3C(CCC3N=C(N2)N)CC1C |
| SMILES (Isomeric) | CCCCC1=C2[C@@H]3[C@@H](CC[C@@H]3N=C(N2)N)C[C@@H]1C |
| InChI | InChI=1S/C15H25N3/c1-3-4-5-11-9(2)8-10-6-7-12-13(10)14(11)18-15(16)17-12/h9-10,12-13H,3-8H2,1-2H3,(H3,16,17,18)/t9-,10-,12-,13+/m0/s1 |
| InChI Key | MGZKFJKGMKJURC-XRRVDJEJSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.204847810 g/mol |
| Topological Polar Surface Area (TPSA) | 50.40 Ų |
| XlogP | 2.30 |
| Isoptilocauline |
| 78777-02-3 |
| Cyclopenta(de)quinazolin-2-amine, 8-butyl-1,3a,4,5,5a,6,7,8b-octahydro-7-methyl-, (3aS-(3aalpha,5aalpha,7alpha,8balpha))- |
| Ptilocauline |
| CHEMBL454881 |
| DTXSID501000014 |
| 8-Butyl-7-methyl-3,3a,4,5,5a,6,7,8b-octahydrocyclopenta[de]quinazolin-2(1H)-imine |
| (1S,4S,10S,12R)-9-butyl-10-methyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.75% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.65% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.67% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.55% | 95.93% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.39% | 95.58% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.31% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.49% | 92.86% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 87.60% | 86.00% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.07% | 90.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.70% | 98.59% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.26% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.32% | 95.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.03% | 98.03% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.91% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.32% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.04% | 92.94% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.82% | 92.68% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.00% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.90% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.46% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.14% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 127598 |
| LOTUS | LTS0137059 |
| wikiData | Q82993362 |