Pseudoalterobactin A
| Internal ID | 5500a7bc-de8c-4981-87ff-23300f59e482 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 3-[[4-amino-2-[[4-amino-8-[(2,3-dihydroxy-4-sulfobenzoyl)amino]-3-hydroxyoctanoyl]amino]-4-oxobutanoyl]amino]-4-[[9-(4-aminobutyl)-6-[carboxy(hydroxy)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]amino]-2-hydroxy-4-oxobutanoic acid |
| SMILES (Canonical) | C1CCNC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(C1)NC(=O)C(C(C(=O)O)O)NC(=O)C(CC(=O)N)NC(=O)CC(C(CCCCNC(=O)C2=C(C(=C(C=C2)S(=O)(=O)O)O)O)N)O)CCCCN)C(C(=O)O)O |
| SMILES (Isomeric) | C1CCNC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(C1)NC(=O)C(C(C(=O)O)O)NC(=O)C(CC(=O)N)NC(=O)CC(C(CCCCNC(=O)C2=C(C(=C(C=C2)S(=O)(=O)O)O)O)N)O)CCCCN)C(C(=O)O)O |
| InChI | InChI=1S/C41H63N11O21S/c42-12-4-1-8-21-36(63)51-28(32(59)40(67)68)38(65)47-17-27(56)45-13-6-3-9-20(35(62)49-21)50-39(66)29(33(60)41(69)70)52-37(64)22(15-25(44)54)48-26(55)16-23(53)19(43)7-2-5-14-46-34(61)18-10-11-24(74(71,72)73)31(58)30(18)57/h10-11,19-23,28-29,32-33,53,57-60H,1-9,12-17,42-43H2,(H2,44,54)(H,45,56)(H,46,61)(H,47,65)(H,48,55)(H,49,62)(H,50,66)(H,51,63)(H,52,64)(H,67,68)(H,69,70)(H,71,72,73) |
| InChI Key | ULYRNACUAOJJBY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C41H63N11O21S |
| Molecular Weight | 1078.10 g/mol |
| Exact Mass | 1077.39206923 g/mol |
| Topological Polar Surface Area (TPSA) | 566.00 Ų |
| XlogP | -10.30 |
| Atomic LogP (AlogP) | -7.94 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 25 |
| RefChem:176893 |
| 3-((4-amino-2-((4-amino-8-((2,3-dihydroxy-4-sulfobenzoyl)amino)-3-hydroxyoctanoyl)amino)-4-oxobutanoyl)amino)-4-((9-(4-aminobutyl)-6-(carboxy(hydroxy)methyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl)amino)-2-hydroxy-4-oxobutanoic acid |
| 691850-60-9 |
| alpha-Asparagine, N2-(4-amino-8-((2,3-dihydroxy-4-sulfobenzoyl)amino)-3-hydroxy-1-oxooctyl)asparaginyl-N-(9-(4-aminobutyl)-6-(carboxyhydroxymethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetraazacyclohexadec-12-yl)-3-hydroxy- |
| SCHEMBL29855349 |
| CHEBI:210007 |
| 3-[[4-amino-2-[[4-amino-8-[(2,3-dihydroxy-4-sulobenzoyl)amino]-3-hydroxyoctanoyl]amino]-4-oxobutanoyl]amino]-4-[[9-(4-aminobutyl)-6-[carboxy(hydroxy)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]amino]-2-hydroxy-4-oxobutanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.6993 | 69.93% |
| Caco-2 | - | 0.8590 | 85.90% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.5571 | 55.71% |
| Subcellular localzation | Nucleus | 0.5454 | 54.54% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8432 | 84.32% |
| OATP1B3 inhibitior | + | 0.9378 | 93.78% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.5522 | 55.22% |
| P-glycoprotein inhibitior | + | 0.7401 | 74.01% |
| P-glycoprotein substrate | + | 0.8798 | 87.98% |
| CYP3A4 substrate | + | 0.7339 | 73.39% |
| CYP2C9 substrate | - | 0.8108 | 81.08% |
| CYP2D6 substrate | - | 0.8267 | 82.67% |
| CYP3A4 inhibition | - | 0.9364 | 93.64% |
| CYP2C9 inhibition | - | 0.8041 | 80.41% |
| CYP2C19 inhibition | - | 0.7985 | 79.85% |
| CYP2D6 inhibition | - | 0.8720 | 87.20% |
| CYP1A2 inhibition | - | 0.8507 | 85.07% |
| CYP2C8 inhibition | + | 0.7730 | 77.30% |
| CYP inhibitory promiscuity | - | 0.9778 | 97.78% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | + | 0.6492 | 64.92% |
| Carcinogenicity (trinary) | Non-required | 0.6244 | 62.44% |
| Eye corrosion | - | 0.9780 | 97.80% |
| Eye irritation | - | 0.8963 | 89.63% |
| Skin irritation | - | 0.7656 | 76.56% |
| Skin corrosion | - | 0.8945 | 89.45% |
| Ames mutagenesis | - | 0.5898 | 58.98% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3863 | 38.63% |
| Micronuclear | + | 0.9600 | 96.00% |
| Hepatotoxicity | - | 0.5148 | 51.48% |
| skin sensitisation | - | 0.8449 | 84.49% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.6556 | 65.56% |
| Mitochondrial toxicity | + | 0.7250 | 72.50% |
| Nephrotoxicity | - | 0.6952 | 69.52% |
| Acute Oral Toxicity (c) | III | 0.5753 | 57.53% |
| Estrogen receptor binding | + | 0.7434 | 74.34% |
| Androgen receptor binding | + | 0.7063 | 70.63% |
| Thyroid receptor binding | + | 0.5218 | 52.18% |
| Glucocorticoid receptor binding | + | 0.5377 | 53.77% |
| Aromatase binding | + | 0.6530 | 65.30% |
| PPAR gamma | + | 0.6979 | 69.79% |
| Honey bee toxicity | - | 0.7093 | 70.93% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6600 | 66.00% |
| Fish aquatic toxicity | + | 0.7591 | 75.91% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 100.00% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.95% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.70% | 97.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.54% | 97.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.32% | 88.42% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.00% | 93.10% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 95.67% | 92.88% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 95.34% | 96.11% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 94.81% | 82.86% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.64% | 95.50% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 94.60% | 93.18% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.43% | 98.94% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.42% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.77% | 93.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.55% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.50% | 90.20% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.21% | 98.05% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 92.98% | 80.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.16% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.56% | 93.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.14% | 96.90% |
| CHEMBL1801 | P00747 | Plasminogen | 90.69% | 92.44% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.59% | 98.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.55% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.94% | 96.38% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 88.77% | 98.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.43% | 97.14% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.88% | 93.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.84% | 94.33% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.40% | 91.03% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 87.27% | 94.01% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.10% | 95.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.11% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.06% | 91.19% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.83% | 90.08% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.57% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.32% | 98.75% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 85.19% | 99.23% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.52% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.77% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.74% | 92.94% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.35% | 100.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.45% | 97.33% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 82.28% | 96.67% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 82.05% | 88.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11434714 |
| LOTUS | LTS0236964 |
| wikiData | Q77519402 |